| |
| |
| |
| | Methylene chloride (Dichloromethane) |
|
| |
| | Diethylene glycol (except if it is present as an unavoidable trace amount up to a limit of 0.1% in the finished cosmetic product) |
|
| |
| |
| |
| | N,N-diethyl-m-toluamide/Diethyltoluamide (DEET) |
|
| | N-5-Chlorobenzoxazol-2-ylacetamide |
|
| | 2-Acetoxyethyl trimethylammonium hydroxide (acetylcholine) and its salts |
|
| |
| |
| | [4-(4-Hydroxy-3-iodophenoxy)-3,5-diodophenyl] acetic acid and its salts |
|
| |
| | Aminocaproic acid and its salts |
|
| | Cinchophen, its salts, derivatives and salts of these derivatives |
|
| | Thyropropic acid and its salts |
|
| |
| | Aconitum napellus L. (leaves, roots and galenical preparations) |
|
| | Aconitine (principal alkaloid of Aconitum napellus L.) and its salts |
|
| | Adonis vernalis L. and its preparations |
|
| |
| | Rauwolfia serpentina alkaloids and their salts |
|
| | Alkyne alcohols, their esters, ethers and salts |
|
| |
| |
| | Alloclamide and its salts |
|
| | Nalorphine, its salts and ethers |
|
| | Sympathicomimetic amines acting on the central nervous system |
|
| | Aniline, its salts and its halogenated and sulphonated derivatives |
|
| | Betoxycaine and its salts |
|
| |
| | Procainamide, its salts and derivatives |
|
| |
| | Tuaminoheptane, its isomers and salts |
|
| |
| | 2-Amino-1,2-bis(4-methoxyphenyl) ethanol and its salts |
|
| | 1,3-dimethylpentylamine and its salts |
|
| | 4-Aminosalicylic acid and its salts |
|
| | Toluidines, their isomers, salts and halogenated and sulphonated derivatives |
|
| | Xylidines, their isomers, salts and halogenated and sulphonated derivatives |
|
| | lmperatorin (9-(3-methylbut-2-enyloxy) furo(3,2-g) chromen-7-one) |
|
| | Ammi majus and its galenical preparations |
|
| | 2,3-Dichloro-2-methylbutane |
|
| | Substances with androgenic effect |
|
| |
| |
| | Antimony and its compounds |
|
| | Apocynum cannabinum L. and its preparations |
|
| | Apomorphine ((R)5,6,6a,7-tetrahydro-6-methyl-4H-dibenzo-[d,e,g]-quinoline-10,11-diol) and its salts |
|
| | Arsenic and its compounds |
|
| | Atropa belladonna L. and its preparations |
|
| | Atropine, its salts and derivatives |
|
| | Barium salts and barium peroxide, with the exception of barium sulphide under the conditions laid down under reference number 23, Part II, and of barium sulphate, lakes, salts and pigments prepared from colouring agents listed in Part III |
|
| |
| |
| | Benzazepines and benzodiazepines |
|
| | 1-Dimethylaminomethyl-1-methylpropyl benzoate (amylocaine) and its salts |
|
| | 2,2,6-Trimethyl-4-piperidyl benzoate (benzamine) and its salts |
|
| |
| | Bendroflumethiazide and its derivatives |
|
| | Beryllium and its compounds |
|
| |
| |
| |
| |
| | Brompheniramine and its salts |
|
| |
| |
| |
| |
| |
| |
| |
| |
| | Cadmium and its compounds |
|
| | Cantharides, Cantharis vesicatoria |
|
| | (1R,2S)-Hexahydro-1,2-dimethyl-3,6-epoxyphthalic anhydride (cantharidin) |
|
| |
| | Nitroderivatives of carbazole |
|
| |
| |
| |
| | Chenopodium ambrosioides (essential oil) |
|
| | 2,2,2-Trichloroethane-1,1-diol |
|
| |
| |
| | Diphenoxylate hydrochloride |
|
| | 4-Phenylazophenylene-1,3-diamine citrate hydrochloride (Chrysoidine citrate hydrochloride) |
|
| |
| | 2-Chloro-6-methylpyrimidin-4-yldimethylamine; (Crimidine-ISO) |
|
| | Chlorprothixene and its salts |
|
| |
| | N,N-bis(2-Chloroethyl) methylamine N-oxide and its salts |
|
| | Chlormethine and its salts |
|
| | Cyclophosphamide and its salts |
|
| | Mannomustine and its salts |
|
| | Butanilicaine and its salts |
|
| |
| |
| | 2-[2-(4-Chlorophenyl)-2-phenylacetyl] indan 1,3-dione (Chlorophacinone-ISO) |
|
| |
| |
| |
| | Chromium; chromic acid and its salts |
|
| | Calviceps purpurea Tul., its alkaloids and galenical preparations |
|
| | Conium maculatum L. (fruit, powder, galenical preparations) |
|
| |
| |
| | Colchicine, its salts and derivatives |
|
| | Colchicoside and its derivatives |
|
| | Colchicum autumnale L. and its galenical preparations |
|
| |
| | Anamirta cocculus L. (fruit) |
|
| |
| | 1-Butyl-3-(N-crotonoylsulphanilyl) urea |
|
| |
| |
| | Hydrogen cyanide and its salts |
|
| | 2-α-Cyclohexylbenzyl (N,N,N’,N’-tetraethyl) trimethylenediamine (phenetamine) |
|
| |
| |
| |
| |
| | O,O’-Diacetyl-N-allyl-N-normorphine; Diacetylnalorphine |
|
| |
| | 5-(α,β-Dibromophenethyl)-5-methylhydantoin |
|
| | N,N’-Pentamethylenebis(trimethylammonium) salts, e.g. pentamethonium bromide |
|
| | N,N’-[(Methylimino)diethylene]bis(ethyldimethylammonium) salts, e.g. azamethonium bromide |
|
| |
| |
| | N,N’-Hexamethylenebis(trimethylammonium) salts, e.g. hexamethonium bromide |
|
| | Dichloroethanes (ethylene chlorides) |
|
| | Dichloroethylenes (acetylene chlorides) |
|
| |
| | 2-Diethylaminoethyl 3-hydroxy-4-phenylbenzoate and its salts |
|
| | Cinchocaine and its salts |
|
| | 3-Diethylaminopropyl cinnamate |
|
| | O,O’-Diethyl-O-4-nitrophenyl phosphorothioate (Parathion-ISO) |
|
| | [Oxalylbis(iminoethylene)]bis[(o-chlorobenzyl) diethylammonium] salts, e.g. ambenonium chloride |
|
| | Methyprylon and its salts |
|
| | Digitaline and all heterosides of Digitalis purpurea L. |
|
| | 7-[2-Hydroxy-3-(N-(2-hydroxyethyl)-N-methylamino) propyl] theophylline; (xanthinol) |
|
| | Dioxethedrin and its salts |
|
| |
| |
| | Tetrabenazine and its salts |
|
| |
| | Mefeclorazine and its salts |
|
| |
| | 1,1-bis(dimethylaminomethyl) propyl benzoate (amydricaine, alypine) and its salts |
|
| | Methapyrilene and its salts |
|
| | Metamfepramone and its salts |
|
| | Amitriptyline and its salts |
|
| |
| |
| |
| |
| |
| |
| |
| | Diphenylpyraline and its salts |
|
| |
| | N-(3-Carbamoyl-3,3-diphenylpropyl)-N,N-diisopropylmethylammonium salts, e.g. isopropamide iodide |
|
| |
| | Benzatropine and its salts |
|
| |
| | 5,5-Diphenyl-4-imidazolidone |
|
| |
| |
| | Emetine, its salts and derivatives |
|
| |
| | Oxanamide and its derivatives |
|
| | Eserine or physostigmine and its salts |
|
| | 4-Aminobenzoic acid and its esters, with the free amino group |
|
| | Choline salts and their esters, e.g. choline chloride |
|
| |
| | Diethyl 4-nitrophenyl phosphate |
|
| | Metethoheptazine and its salts |
|
| | Oxpheneridine and its salts |
|
| | Ethoheptazine and its salts |
|
| | Metheptazine and its salts |
|
| | Methylphenidate and its salts |
|
| |
| |
| | 4-Benzyloxyphenol and 4-ethoxyphenol |
|
| | Parethoxycaine and its salts |
|
| |
| | Glutethimide and its salts |
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | Hydrofluoric acid, its normal salts, its complexes and hydrofluorides with the exception of those listed in Part II |
|
| | Furfuryltrimethylammonium salts, e.g. furtrethonium iodide |
|
| |
| |
| | 1,2,3,4,5,6-Hexachlorocyclohexane (BHC-ISO) |
|
| | (1R,4S,5R,8S)-1,2,3,4,10,10-Hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4:5,8-dimethanonaphthalene (Endrin-ISO) |
|
| |
| | (1R,4S,5R,8S)-1,2,3,4,10,10-Hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalene (isodrin-ISO) |
|
| | Hydrastine, hydrastinine and their salts |
|
| | Hydrazides and their salts |
|
| | Hydrazine, its derivatives and their salts |
|
| |
| |
| | Ethyl bis(4-hydroxy-2-oxo-1-benzopyran-3-yl) acetate and salts of the acid |
|
| |
| |
| | 4,4’-Dihydroxy-3,3’-(3-methylthiopropylidene) dicoumarin |
|
| |
| | Nitroxoline and its salts |
|
| | Hyoscyamine, its salts and derivatives |
|
| | Hyoscyamus niger L. (leaves, seeds, powder and galenical preparations) |
|
| |
| |
| | Decamethylenebis(trimethylammonium) salts, e.g. decamethonium bromide |
|
| | Ipecacuanha (Cephaelis ipecacuanha Brot. and related species) (roots, powder and galenical preparations) |
|
| | (2-Isopropylpent-4-enoyl)urea (apronalide) |
|
| | α-Santonin [(3S,5aR,9bS)-3,3a,4,5,5a,9b-hexahydro-3,5a,9-trimethylnaphto [1,2-b] furan-2,8-dione] |
|
| | Lobelia inflata L. and its galenical preparations |
|
| |
| |
| | Mercury and its compounds |
|
| | 3,4,5-Trimethoxyphenethylamine and its salts |
|
| |
| | 2-(4-Allyl-2-methoxyphenoxy)-N,N-diethylacetamide and its salts |
|
| |
| | Dextromethorphan and its salts |
|
| | 2-Methylheptylamine (2-(N-methyl)heptylamine) and its salts |
|
| | Isometheptene and its salts |
|
| |
| |
| |
| | Phenmetrazine, its derivatives and salts |
|
| |
| | 3,4-Dihydro-2-methoxy-2-methyl-4-phenyl-2H,5H,pyrano(3,2-c)-(1) benzopyran-5-one (cyclocoumarol) |
|
| |
| |
| |
| |
| |
| |
| |
| | 1-and 2-Naphthylamines and their salts |
|
| | 3-(1-Naphthyl)-4-hydroxycoumarin |
|
| | Naphazoline and its salts |
|
| | Neostigmine and its salts (e.g. neostigmine bromide) |
|
| |
| |
| | Inorganic nitrites, with the exception of sodium nitrite |
|
| |
| | Nitrocresols and their alkali metal salts |
|
| |
| |
| | Propane-1,2,3-triyl trinitrate |
|
| |
| | Alkali pentacyanonitrosylferrate (2-) |
|
| | Nitrostilbenes, their homologues and their derivatives |
|
| | Noradrenaline and its salts |
|
| |
| | Guanethidine and its salts |
|
| |
| |
| |
| | Pelletierine and its salts |
|
| |
| | Pentaerithrityl tetranitrate |
|
| |
| | Octamylamine and its salts |
|
| |
| |
| |
| | 2-Phenylindan-1,3-dione (Phenindione) |
|
| | Ethylphenacemide (Pheneturide) |
|
| |
| |
| | Triamterene and its salts |
|
| | Tetraethyl pyrophosphate; TEPP-(ISO) |
|
| |
| |
| | Phosphorus and metal-phosphides |
|
| | Thalidomide and its salts |
|
| | Physostigma venenosum Balf. |
|
| |
| | Pilocarpine and its salts |
|
| | α-Piperidin-2-yl benzyl acetate laevorotatory threoform (Levophacetoperane) and its salts |
|
| |
| | Azacyclonol and its salts |
|
| |
| | Butopiprine and its salts |
|
| |
| |
| | Prunus laurocerasus L. (“cherry laurel water”) |
|
| |
| |
| | Juniperus sabina L. (leaves, essential oil and galenical preparations) |
|
| | Hyoscine, its salts and derivatives |
|
| |
| | Selenium and its compounds with the exception of selenium disulphide under the conditions laid down under reference number 49, Part II |
|
| | Solanum nigrum L. and its galenical preparations |
|
| |
| |
| | Datura stramonium L. and its galenical preparations |
|
| | Strophantines, their aglucones and their respective derivatives |
|
| | Strophantus species and their galenical preparations |
|
| |
| | Strychnos species and their galenical preparations |
|
| | Narcotics, natural and synthetic |
|
| | Sulphanilamide and its derivatives obtained by substitution of one or more H-atoms of the -NH2 groups, and their salts |
|
| |
| |
| |
| | Pilocarpus jaborandi Holmes and its galenical preparations |
|
| | Tellurium and its compounds |
|
| | Xylometazoline and its salts |
|
| |
| |
| |
| | Thallium and its compounds |
|
| | Thevetia neriifolia Juss., Glycoside extract |
|
| |
| | Phenothiazine and its compounds |
|
| | Thiourea and its derivatives, with the exception of the one listed in Part II |
|
| | Mephenesin and its esters |
|
| | Vaccines, toxins or serums |
|
| | Tranylcypromine and its salts |
|
| | Trichloronitromethane (chloropicrine) |
|
| | 2,2,2-Tribromoethanol (tribromoethyl alcohol) |
|
| | Trichlormethine and its salts |
|
| |
| |
| | Urginea scilla Stern. and its galenical preparations |
|
| | Veratrine, its salts and galenical preparations |
|
| | Schoenocaulon officinale Lind. (seeds and galenical preparations) |
|
| | Veratrum Spp. and their preparations |
|
| |
| | Ergocalciferol and Cholecalciferol (vitamins D2 and D3) |
|
| | Salts of O-alkyldithiocarbonic acids |
|
| |
| |
| | Diphenhydramine and its salts |
|
| |
| |
| |
| |
| |
| | Pyrethrum album L. and its galenical preparations |
|
| | 2-[4-Methoxybenzyl-N-(2-pyridyl)amino]ethyldimethylamine maleate |
|
| |
| | Tetrachlorosalicylanilides |
|
| |
| | Tetrabromosalicylanilides |
|
| |
| |
| |
| |
| |
| |
| | Benzoates of 4-hydroxy-3-methoxycinnamyl alcohol except for normal content in natural essences used |
|
| | Furocoumarines (e.g. trioxysalen, 8-methoxypsoralen, 5-methoxypsoralen) except for normal content in natural essences used. In sun protection and in bronzing products, furocoumarines must be below 1 mg/kg |
|
| | Oil from the seeds of Laurus nobilis L. |
|
| | Safrole except for normal content in natural essences used and provided the concentration does not exceed: |
| (a) | 100 ppm in the finished cosmetic product |
|
| (b) | 50 ppm in products for dental and oral hygiene, and provided that Safrole is not present in toothpastes intended specifically for children |
|
|
| | 5,5’-Di-isopropyl-2,2’-dimethylbiphenyl-4,4’-diyl dihypoiodite |
|
| | 3’-Ethyl-5’,6’,7’,8’-tetrahydro-5’,5’,8’,8’-tetramethyl-2’-acetonaphthone or 7-acetyl-6-ethyl-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalen |
|
| | o-phenylenediamine and its salts |
|
| | 4-Methyl-m-phenylenediamine and its salts |
|
| | Aristolochic acid and its salts, Aristolochia Spp. and their preparations |
|
| |
| | 2,3,7,8-Tetrachlorodibenzo-p-dioxin |
|
| | 2,6-Dimethyl-1,3-dioxan-4-yl acetate (Dimethoxane) |
|
| |
| | N-(Trichloromethylthio)-4-cyclohexene-1,2-dicarboximide (captan) |
|
| | 2,2’-Dihydroxy-3,3’,5,5’,6,6’-hexachlorodiphenylmethane (hexachlorophene) |
|
| | 6-(Piperidinyl)-2,4-pyrimidinediamine-3-oxide (minoxidil) and its salts |
|
| | 3,4’,5-Tribromosalicylanilide |
|
| | Phytolacca Spp. and their preparations |
|
| | Tretinoin (retinoic acid and its salts) |
|
| | 1-Methoxy-2,4-diaminobenzene (2,4-Diaminoanisole — Cl 76050) and their salts |
|
| | 1-Methoxy-2,5-diaminobenzene (2,5-Diaminoanisole) and their salts |
|
| |
| |
| | Colouring agent CI 42555:1 |
| Colouring agent CI 42555:2 |
|
| | Amyl 4-dimethylaminobenzoate, mixed isomers (Padimate A) |
|
| |
| |
| | 11α-hydroxypregn-4-ene-3,20-dione and its esters |
|
| |
| |
| |
| |
| | Anti-androgens of steroidal structure |
|
| | Zirconium and its compounds, with the exception of the substances listed under reference number 50, Part II, and the zirconium lakes, pigments and salts of the colouring agents listed in Part III |
|
| |
| | Tetrahydrozoline (Tetryzoline) and its salts |
|
| | Hydroxy-8-quinoline and its sulphate, except for the uses provided for under reference number 51, Part II |
|
| | Dithio-2,2’-bispyridine-dioxide-1,1’ (additive with trihydrated magnesium sulphate) - (pyrithione disulphide + magnesium sulphate) |
|
| | Colouring agent CI 12075 and its lakes, pigments and salts |
|
| | Colouring agent CI 45170 and colouring agent CI 45170:1 |
|
| |
| |
| |
| |
| |
| | Strontium polycarboxylate |
|
| |
| | 4-Ethoxy-m-phenylenediamine and its salts |
|
| | 2,4-Diaminophenylethanol and its salts |
|
| |
| |
| |
| | Secondary alkyl- and alkanolamines and their salts |
|
| |
| | 2-Methyl-m-phenylenediamine |
|
| | 4-tert-Butyl-3-methoxy-2,6-dinitrotoluene (Musk ambrette) |
|
| | Cells, tissues or products of human origin |
|
| | 3,3-bis(4-hydroxyphenyl)phthalide (Phenolphthalein) |
|
| | 3-Imidazol-4-ylacrylic acid and its ethyl ester (Urocanic acid) |
|
| | Category 1 material and Category 2 material (as defined in the definition of “animal products” in the ASEAN Cosmetic Directive)1 |
|
| | Crude and refined coal tars |
|
| | 1,1,3,3,5-Pentamethyl-4,6-dinitroindane (Moskene) |
|
| | 5-tert-Butyl-1,2,3-trimethyl-4,6-dinitrobenzene (Musk tibetene) |
|
| | Alanroot oil (Inula helenium), when used as a fragrance ingredient |
|
| | Benzyl cyanide, when used as a fragrance ingredient |
|
| | Cyclamen alcohol, when used as a fragrance ingredient |
|
| | Diethyl maleate, when used as a fragrance ingredient |
|
| | Dihydrocoumarin, when used as a fragrance ingredient |
|
| | 2,4-Dihydroxy-3-methylbenzaldehyde, when used as a fragrance ingredient |
|
| | 3,7-Dimethyl-2-octen-1-ol (6,7-Dihydrogeraniol), when used as a fragrance ingredient |
|
| | 4,6-Dimethyl-8-tert-butylcoumarin, when used as a fragrance ingredient |
|
| | Dimethyl citraconate, when used as a fragrance ingredient |
|
| | 7,11-Dimethyl-4,6,10-dodecatrien-3-one, when used as a fragrance ingredient |
|
| | 6,10-Dimethyl-3,5,9-undecatrien-2-one, when used as a fragrance ingredient |
|
| | Diphenylamine, when used as a fragrance ingredient |
|
| | Ethyl acrylate, when used as a fragrance ingredient |
|
| | Fig leaf absolute (Ficus carica), when used as a fragrance ingredient |
|
| | trans-2-Heptenal, when used as a fragrance ingredient |
|
| | trans-2-Hexenal diethyl acetal, when used as a fragrance ingredient |
|
| | trans-2-Hexenal dimethyl acetal, when used as a fragrance ingredient |
|
| | Hydroabietyl alcohol, when used as a fragrance ingredient |
|
| | 6-Isopropyl-2-decahydronaphthalenol, when used as a fragrance ingredient |
|
| | 7-Methoxycoumarin, when used as a fragrance ingredient |
|
| | 4-(4-Methoxyphenyl)-3-butene-2-one, when used as a fragrance ingredient |
|
| | 1-(4-Methoxyphenyl)-1-penten-3-one, when used as a fragrance ingredient |
|
| | Methyl trans-2-butenoate, when used as a fragrance ingredient |
|
| | 7-Methylcoumarin, when used as a fragrance ingredient |
|
| | 5-Methyl-2,3-hexanedione, when used as a fragrance ingredient |
|
| | 2-Pentylidenecyclohexanone, when used as a fragrance ingredient |
|
| | 3,6,10-Trimethyl-3,5,9-undecatrien-2-one, when used as a fragrance ingredient |
|
| | Verbena essential oils (Lippia citriodora Kunth.) and derivatives other than absolute Verbena, when used as a fragrance ingredient |
|
| | Methyleugenol except for normal content in the natural essences used and provided that the concentration does not exceed: |
| (a) | 0.01% in fine fragrance |
|
| (b) | 0.004% in eau de toilette |
|
| (c) | 0.002% in fragrance cream |
|
| (d) | 0.001% in rinse-off products |
|
| (e) | 0.0002% in other leave-on products and oral hygiene products |
|
|
| | 6-(2-Chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | Isobutane, if it contains ≥ 0.1% w/w Butadiene |
|
| | Butane, if it contains ≥ 0.1% w/w Butadiene |
|
| | Gases (petroleum), C3-4, if they contain > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic cracked distillate and catalytic cracked naphtha fractionation absorber, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic polymerisation naphtha fractionation stabiliser, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic reformed naphtha fractionation stabiliser, hydrogen sulfide-free, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), cracked distillate hydrotreater stripper, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), gas oil catalytic cracking absorber, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), gas recovery plant, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), gas recovery plant deethaniser, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), hydrodesulfurised distillate and hydrodesulfurised naphtha fractionator, acid-free, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), hydrodesulfurised vacuum gas oil stripper, hydrogen sulfide-free, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), isomerised naphtha fractionation stabiliser, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), light straight-run naphtha stabiliser, hydrogen sulfide-free, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), straight-run distillate hydrodesulfurised, hydrogen sulfide-free, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), propane-propylene alkylation feed prep deethaniser, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), vacuum gas oil hydrodesulfurised, hydrogen sulfide-free, if it contains > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic cracked overheads, if they contain > 0.1% w/w Butadiene |
|
| | Alkanes, C1-2, if they contain > 0.1% w/w Butadiene |
|
| | Alkanes, C2-3, if they contain > 0.1% w/w Butadiene |
|
| | Alkanes, C3-4, if they contain > 0.1% w/w Butadiene |
|
| | Alkanes, C4-5, if they contain > 0.1% w/w Butadiene |
|
| | Fuel gases, if they contain > 0.1% w/w Butadiene |
|
| | Fuel gases, crude oil distillates, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C3-4, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C4-5, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C2-4, C3-rich, if they contain > 0.1% w/w Butadiene |
|
| | Petroleum gases, liquefied, if they contain > 0.1% w/w Butadiene |
|
| | Petroleum gases, liquefied, sweetened, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), C3-4, isobutane-rich, if they contain > 0.1% w/w Butadiene |
|
| | Distillates (petroleum), C3-6, piperylene-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), amine system feed, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), benzene unit hydrodesulfurised off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), benzene unit recycle, hydrogen-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), blend oil, hydrogen-nitrogen-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), butane splitter overheads, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), C2-3, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic-cracked gas oil depropaniser bottoms, C4-rich acid-free, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic-cracked naphtha debutaniser bottoms, C3-5-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic cracked naphtha depropaniser overhead, C3-rich acid-free, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic cracker, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic cracker, C1-5-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic polymerisation naphtha stabiliser overhead, C2-4-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic reformed naphtha stripper overheads, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic reformer, C1-4-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), C6-8 catalytic reformer recycle, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), C6-8 catalytic reformer, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), C6-8 catalytic reformer recycle, hydrogen-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), C3-5 olefinic-paraffinic alkylation feed, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), C2-return stream, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), C4-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), deethaniser overheads, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), deisobutaniser tower overheads, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), depropaniser dry, propene-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), depropaniser overheads, if they contain > 0.1 % w/w Butadiene |
|
| | Gases (petroleum), dry sour, gas-concentration-unit-off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), gas concentration reabsorber distillation, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), gas recovery plant depropaniser overheads, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), Girbatol unit feed, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), hydrogen absorber off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), hydrogen-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), hydrotreater blend oil recycle, hydrogen-nitrogen-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), isomerised naphtha fractionator, C4-rich, hydrogen sulphide-free, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), recycle, hydrogen-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), reformer make-up, hydrogen-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), reforming hydrotreater, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), reforming hydrotreater, hydrogen-methane-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), reforming hydrotreater make-up, hydrogen-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), thermal cracking distillation, if they contain > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic cracked clarified oil and thermal cracked vacuum residue fractionation reflux drum, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic cracked naphtha stabilisation absorber, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic cracker, catalytic reformer and hydrodesulfurised combined fractionater, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic cracker refractionation absorber, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic reformed naphtha fractionation stabiliser, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic reformed naphtha separator, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic reformed naphtha stabiliser, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), cracked distillate hydrotreater separator, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), hydrodesulfurised straight-run naphtha separator, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), saturate gas plant mixed stream, C4-rich, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), saturate gas recovery plant, C1-2-rich, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), vacuum residues thermal cracker, if it contains > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C3-4-rich, petroleum distillate, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic reformed straight-run naphtha stabiliser overheads, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), full-range straight-run naphtha dehexaniser off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), hydrocracking depropaniser off, hydrocarbon-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), light straight-run naphtha stabiliser off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), reformer effluent high-pressure flash drum off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), reformer effluent low-pressure flash drum off, if they contain > 0.1% w/w Butadiene |
|
| | Residues (petroleum), alkylation splitter, C4-rich, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C1-4, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C1-4, sweetened, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), oil refinery gas distillation off, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C1-3, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C1-4, debutaniser fraction, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), benzene unit hydrotreater depentaniser overheads, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), C1-5, wet, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), secondary absorber off, fluidised catalytic cracker overheads fractionator, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C2-4, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C3, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), alkylation feed, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), depropaniser bottoms fractionation off, if they contain > 0.1% w/w Butadiene |
|
| | Petroleum products, refinery gases, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), hydrocracking low-pressure separator, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), refinery blend, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic cracking, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), C2-4, sweetened, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), refinery, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), platformer products separator off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), hydrotreated sour kerosine depentaniser stabiliser off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), hydrotreated sour kerosine flash drum, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), crude oil fractionation off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), dehexaniser off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), distillate unifiner desulfurisation stripper off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), fluidised catalytic cracker fractionation off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), fluidised catalytic cracker scrubbing secondary absorber off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), heavy distillate hydrotreater desulfurisation stripper off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), light straight run gasoline fractionation stabiliser off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), naphtha unifiner desulfurisation stripper off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), platformer stabiliser off, light ends fractionation, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), preflash tower off, crude distillation, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), straight-run naphtha catalytic reforming off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), straight-run stabiliser off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), tar stripper off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), unifiner stripper off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), fluidised catalytic cracker splitter overheads, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), catalytic cracked naphtha debutaniser, if they contain > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic cracked distillate and naphtha stabiliser, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), catalytic hydrodesulfurised naphtha separator, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), straight-run naphtha hydrodesulfurised, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), thermal-cracked distillate, gas oil and naphtha absorber, if it contains > 0.1% w/w Butadiene |
|
| | Tail gas (petroleum), thermal cracked hydrocarbon fractionation stabiliser, petroleum coking, if it contains > 0.1% w/w Butadiene |
|
| | Gases (petroleum), light steam-cracked, butadiene concentration, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), sponge absorber off, fluidised catalytic cracker and gas oil desulfuriser overhead fractionation, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), straight-run naphtha catalytic reformer stabiliser overhead, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), crude distillation and catalytic cracking, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C4, if they contain > 0.1% w/w Butadiene |
|
| | Alkanes, C1-4, C3-rich, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), gas oil diethanolamine scrubber off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), gas oil hydrodesulfurisation effluent, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), gas oil hydrodesulfurisation purge, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), hydrogenator effluent flash drum off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), naphtha steam cracking high-pressure residual, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), residue visbreaking off, if they contain > 0.1% w/w Butadiene |
|
| | Gases (petroleum), steam-cracker C3-rich, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C4, steam-cracker distillate, if they contain > 0.1% w/w Butadiene |
|
| | Petroleum gases, liquefied, sweetened, C4 fraction, if they contain > 0.1% w/w Butadiene |
|
| | Hydrocarbons, C4, 1,3-butadiene- and isobutene-free, if they contain > 0.1% w/w Butadiene |
|
| | Raffinates (petroleum), steam-cracked C4 fraction cuprous ammonium acetate extraction, C3-5 and C3-5 unsaturated, butadiene-free, if they contain > 0.1% w/w Butadiene |
|
| | Benzo[def]chrysene (=benzo[a]pyrene) |
|
| | Pitch, coal tar-petroleum, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Distillates (coal-petroleum), condensed-ring aromatic, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Creosote oil, acenaphthene fraction, acenaphthene-free, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Pitch, coal tar, low-temperature, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Pitch, coal tar, low-temperature, heat-treated, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Pitch, coal tar, low-temperature, oxidised, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Extract residues (coal), brown, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Paraffin waxes (coal), brown-coal high-temperature tar, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Paraffin waxes (coal), brown-coal high-temperature tar, hydrotreated, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Waste solids, coal-tar pitch coking, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Pitch, coal tar, high-temperature, secondary, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Residues (coal), liquid solvent extraction, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Coal liquids, liquid solvent extraction solution, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Coal liquids, liquid solvent extraction, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Paraffin waxes (coal), brown-coal high-temperature tar, carbon-treated, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Paraffin waxes (coal), brown-coal high-temp tar, clay-treated, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Paraffin waxes (coal), brown-coal high-temp tar, silicic acid-treated, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Absorption oils, bicyclo aromatic and heterocyclic hydrocarbon fraction, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene polypropylene pyrolysis-derived, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene pyrolysis-derived, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polystyrene pyrolysis-derived, if they contain > 0.005% w/w benzo[a]pyrene |
|
| | Pitch, coal tar, high-temperature, heat-treated, if it contains > 0.005% w/w benzo[a]pyrene |
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | 1,2-Dibromo-3-chloropropane |
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | 1-Chloro-2,3-epoxypropane |
|
| | R-1-Chloro-2,3-epoxypropane |
|
| | 1,2-Epoxy-3-phenoxypropane |
|
| |
| |
| |
| | (2RS,3RS)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)-[1H-1,2,4-triazol-1-yl)methyl]oxirane; epoxiconazole |
|
| | Chloromethyl methyl ether |
|
| | 2-Methoxyethanol [Ethylene glycol monomethyl ether (EGMME)] |
|
| | 2-Ethoxyethanol [Ethylene glycol monoethyl ether (EGMEE)] |
|
| | Oxybis[chloromethane]; bis(Chloromethyl) ether |
|
| |
| |
| | Dimethylcarbamoyl chloride |
|
| |
| |
| |
| |
| |
| | bis(2-Methyoxyethyl) ether |
|
| | bis(2-Ethylhexyl) phthalate |
|
| | bis(2-Methoxyethyl) phthalate |
|
| |
| | 2-Ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]-methyl]thio] acetate |
|
| | Acrylamide, unless listed elsewhere in this Schedule |
|
| |
| |
| | Dinoseb, its salts and esters with the exception of those listed elsewhere in this Schedule |
|
| |
| |
| | Dinitrotoluene, technical grade |
|
| |
| |
| |
| |
| |
| |
| |
| |
| | Dinoterb, its salts and esters |
|
| |
| |
| |
| | 1,4,5,8-Tetraaminoanthraquinone (Disperse Blue 1) |
|
| |
| | 1-Methyl-3-nitro-1-nitrosoguanidine |
|
| |
| | 2,2’-(Nitrosoimino)bisethanol |
|
| |
| | 4,4’-(4-Iminocyclohexa-2,5-dienylidenemethylene) dianiline hydrochloride |
|
| | 4,4’-Methylenedi-o-toluidine |
|
| |
| |
| |
| | o-Dianisidine based azo dyes |
|
| |
| | Benzidine dihydrochloride |
|
| | [[1,1’-Biphenyl]-4,4’-diyl]diammonium sulphate |
|
| | 3,3’-Dichlorobenzidine dihydrochloride |
|
| |
| |
| | 3,3’-Dichlorobenzidine dihydrogen bis(sulphate) |
|
| | 3,3’-Dichlorobenzidine sulphate |
|
| |
| |
| | 4,4’-Bi-o-toluidine dihydrochloride |
|
| | [3,3’-Dimethyl[1,1’-biphenyl]-4,4’-diyl]diammonium bis(hydrogen sulphate) |
|
| | 4,4’-Bi-o-toluidine sulphate |
|
| |
| | Biphenyl-4-ylamine and its salts |
|
| |
| | (Methyl-ONN-azoxy)methyl acetate |
|
| |
| | 2-Methylaziridine (propyleneimine) |
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | 1,3,5-Tris(oxiranylmethyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione |
|
| |
| |
| |
| |
| |
| |
| | Hexamethylphosphoric-triamide |
|
| |
| |
| |
| | Dimethylsulphamoyl-chloride |
|
| |
| | A mixture of: 4-[[bis-(4-Fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole and 1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole |
|
| | (+/-)-Tetrahydrofurfuryl-(R)-2-[4-(6-chloroquinoxalin-2-yloxy) phenyloxy]propionate |
|
| | 6-Hydroxy-1-(3-Isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo) phenylazo]-1,2-dihydro-3-pyridinecarbonitrile |
|
| | (6-(4-Hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazine-2,4-diyl)bis[(amino-1-methylethyl)ammonium] formate |
|
| | Trisodium [4’-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4”-(6-benzoylamino-3-Sulfonato-2-naphthylazo)-biphenyl-1,3’,3”,1’’’-tetraolato-O,O’,O”,O’’’]copper(II) |
|
| | A mixture of: N-[3-Hydroxy-2-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide and N-2,3-bis-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide and methacrylamide and 2-methyl-N-(2-methylacryloylaminomethoxymethyl)-acrylamide and N-(2,3-dihydroxypropoxymethyl)-2-methylacrylamide |
|
| | 1,3,5-tris-[(2S and 2R)-2,3-Epoxypropyl]-1,3,5-triazine-2,4,6-(1H,3H,5H)-trione |
|
| |
| |
| |
| | Distillates (petroleum), heavy hydrocracked, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-refined heavy paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-refined light paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Residual oils (petroleum), solvent deasphalted, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-refined heavy naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-refined light naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Residual oils (petroleum), solvent-refined, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), clay-treated heavy paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), clay-treated light paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Residual oils (petroleum), clay-treated, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), clay-treated heavy naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), clay-treated light naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), hydrotreated heavy naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), hydrotreated light naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), hydrotreated heavy paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), hydrotreated light paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-dewaxed light paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Residual oils (petroleum), hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Residual oils (petroleum), solvent-dewaxed, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-dewaxed heavy naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-dewaxed light naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-dewaxed heavy paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Foots oil (petroleum), if it contains > 3% w/w DMSO extract |
|
| | Naphthenic oils (petroleum), catalytic dewaxed heavy, if they contain > 3% w/w DMSO extract |
|
| | Naphthenic oils (petroleum), catalytic dewaxed light, if they contain > 3% w/w DMSO extract |
|
| | Paraffin oils (petroleum), catalytic dewaxed heavy, if they contain > 3% w/w DMSO extract |
|
| | Paraffin oils (petroleum), catalytic dewaxed light, if they contain > 3% w/w DMSO extract |
|
| | Naphthenic oils (petroleum), complex dewaxed heavy, if they contain > 3% w/w DMSO extract |
|
| | Naphthenic oils (petroleum), complex dewaxed light, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), heavy naphthenic distillate solvent, aromatic concentration, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), solvent-refined heavy paraffinic distillate solvent, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), heavy paraffinic distillates, solvent-deasphalted, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, high viscosity, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C15-30, hydrotreated neutral oil-based, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), complex dewaxed heavy paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), complex dewaxed light paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent dewaxed heavy paraffinic, clay-treated, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C20-50, solvent dewaxed heavy paraffinic, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent dewaxed light paraffinic, clay-treated, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent dewaxed light paraffinic, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), heavy naphthenic distillate solvent, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), heavy paraffinic distillate solvent, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), light paraffinic distillate solvent, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Residual oils (petroleum), hydrotreated solvent dewaxed, if they contain > 3% w/w DMSO extract |
|
| | Residual oils (petroleum), catalytic dewaxed, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), dewaxed heavy paraffinic, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), dewaxed light paraffinic, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), hydrocracked solvent-refined, dewaxed, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-refined light naphthenic, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), hydrotreated light paraffinic distillate solvent, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), light naphthenic distillate solvent, hydrodesulfurised, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), light paraffinic distillate solvent, acid-treated, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), light paraffinic distillate solvent, hydrodesulfurised, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), light vacuum gas oil solvent, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Foots oil (petroleum), hydrotreated, if it contains > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C17-35, solvent-extracted, dewaxed, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), hydrocracked nonaromatic solvent-deparaffined, if they contain > 3% w/w DMSO extract |
|
| | Residual oils (petroleum), hydrocracked acid-treated solvent-dewaxed, if they contain > 3% w/w DMSO extract |
|
| | Paraffin oils (petroleum), solvent-refined dewaxed heavy, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), heavy paraffinic distillate solvent, clay-treated, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), base oils, paraffinic, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), heavy naphthenic distillate solvent, hydrodesulfurised, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), solvent-dewaxed heavy paraffinic distillate solvent, hydrodesulfurised, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, hydrocracked paraffinic distillation residues, solvent-dewaxed, if they contain > 3% w/w DMSO extract |
|
| | Foots oil (petroleum), acid-treated, if it contains > 3% w/w DMSO extract |
|
| | Foots oil (petroleum), clay-treated, if it contains > 3% w/w DMSO extract |
|
| | Hydrocarbons, C20-50, residual oil hydrogenation vacuum distillate, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-refined hydrotreated heavy, hydrogenated, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-refined hydrocracked light, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrocracked distillate-based, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrogenated raffinate-based, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C13-30, aromatic-rich, solvent-extracted naphthenic distillate, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C16-32, aromatic-rich, solvent-extracted naphthenic distillate, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C37-68, dewaxed deasphalted hydrotreated vacuum distillation residues, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C37-65, hydrotreated deasphalted vacuum distillation residues, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), hydrocracked solvent-refined light, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), solvent-refined hydrogenated heavy, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C18-27, hydrocracked solvent-dewaxed, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C17-30, hydrotreated solvent-deasphalted atmospheric distillation residue, distillation lights, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C17-40, hydrotreated solvent-deasphalted distillation residue, vacuum distillation lights, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C13-27, solvent-extracted light naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C14-29, solvent-extracted light naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Foots oil (petroleum), carbon-treated, if it contains > 3% w/w DMSO extract |
|
| | Foots oil (petroleum), silicic acid-treated, if it contains > 3% w/w DMSO extract |
|
| | Hydrocarbons, C27-42, dearomatised, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C17-30, hydrotreated distillates, distillation lights, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C27-45, naphthenic vacuum distillation, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C27-45, dearomatised, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C20-58, hydrotreated, if they contain > 3% w/w DMSO extract |
|
| | Hydrocarbons, C27-42, naphthenic, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), light paraffinic distillate solvent, carbon-treated, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), light paraffinic distillate solvent, clay-treated, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), light vacuum, gas oil solvent, carbon-treated, if they contain > 3% w/w DMSO extract |
|
| | Extracts (petroleum), light vacuum gas oil solvent, clay-treated, if they contain > 3% w/w DMSO extract |
|
| | Residual oils (petroleum), carbon-treated solvent-dewaxed, if they contain > 3% w/w DMSO extract |
|
| | Residual oils (petroleum), clay-treated solvent-dewaxed, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C25, solvent-extracted, deasphalted, dewaxed, hydrogenated, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C17-32, solvent-extracted, dewaxed, hydrogenated, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C20-35, solvent-extracted, dewaxed, hydrogenated, if they contain > 3% w/w DMSO extract |
|
| | Lubricating oils (petroleum), C24-50, solvent-extracted, dewaxed, hydrogenated, if they contain > 3% w/w DMSO extract |
|
| | Distillates (petroleum), sweetened middle, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Gas oils (petroleum), solvent-refined, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), solvent-refined middle, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Gas oils (petroleum), acid-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), acid-treated middle, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), acid-treated light, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Gas oils (petroleum), chemically neutralised, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), chemically neutralised middle, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), clay-treated middle, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), hydrotreated middle, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Gas oils (petroleum), hydrodesulfurised, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), hydrodesulfurised middle, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), catalytic reformer fractionator residue, high-boiling, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), catalytic reformer fractionator residue, intermediate-boiling, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), catalytic reformer fractionator residue, low-boiling, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Alkanes, C12-26-branched and linear, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), highly refined middle, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), catalytic reformer, heavy aromatic concentration, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Gas oils, paraffinic, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Naphtha (petroleum), solvent-refined hydrodesulfurised heavy, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Hydrocarbons, C16-20, hydrotreated middle distillate, distillation lights, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Hydrocarbons, C12-20, hydrotreated paraffinic, distillation lights, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Hydrocarbons, C11-17, solvent-extracted light naphthenic, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Gas oils, hydrotreated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), carbon-treated light paraffinic, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), intermediate paraffinic, carbon-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), intermediate paraffinic, clay-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Lubricating greases, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Slack wax (petroleum), except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Slack wax (petroleum), acid-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Slack wax (petroleum), clay-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Slack wax (petroleum), hydrotreated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Slack wax (petroleum), low-melting, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Slack wax (petroleum), low-melting, hydrotreated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Slack wax (petroleum), low-melting, carbon-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Slack wax (petroleum), low-melting, clay-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Slack wax (petroleum), low-melting, silicic acid-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Slack wax (petroleum), carbon-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Petrolatum, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Petrolatum (petroleum), oxidised, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Petrolatum (petroleum), alumina-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Petrolatum (petroleum), hydrotreated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Petrolatum (petroleum), carbon-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Petrolatum (petroleum), silicic acid-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Petrolatum (petroleum), clay-treated, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| | Distillates (petroleum), light catalytic cracked |
|
| | Distillates (petroleum), intermediate catalytic cracked |
|
| | Distillates (petroleum), light thermal cracked |
|
| | Distillates (petroleum), hydrodesulfurised light catalytic cracked |
|
| | Distillates (petroleum), light steam-cracked naphtha |
|
| | Distillates (petroleum), cracked steam-cracked petroleum distillates |
|
| | Gas oils (petroleum), steam-cracked |
|
| | Distillates (petroleum), hydrodesulfurised thermal cracked middle |
|
| | Gas oils (petroleum), thermal-cracked, hydrodesulfurised |
|
| | Residues (petroleum), hydrogenated steam-cracked naphtha |
|
| | Residues (petroleum), steam-cracked naphtha distillation |
|
| | Distillates (petroleum), light catalytic cracked, thermally degraded |
|
| | Residues (petroleum), steam-cracked heat-soaked naphtha |
|
| | Gas oils (petroleum), light vacuum, thermal-cracked hydrodesulfurised |
|
| | Distillates (petroleum), hydrodesulfurised middle coker |
|
| | Distillates (petroleum), heavy steam-cracked |
|
| | Residues (petroleum), atmospheric tower |
|
| | Gas oils (petroleum), heavy vacuum |
|
| | Distillates (petroleum), heavy catalytic cracked |
|
| | Clarified oils (petroleum), catalytic cracked |
|
| | Residues (petroleum), catalytic reformer fractionator |
|
| | Residues (petroleum), hydrocracked |
|
| | Residues (petroleum), thermal cracked |
|
| | Distillates (petroleum), heavy thermal cracked |
|
| | Gas oils (petroleum), hydrotreated vacuum |
|
| | Residues (petroleum), hydrodesulfurised atmospheric tower |
|
| | Gas oils (petroleum), hydrodesulfurised heavy vacuum |
|
| | Residues (petroleum), steam-cracked |
|
| | Residues (petroleum), atmospheric |
|
| | Clarified oils (petroleum), hydrodesulfurised catalytic cracked |
|
| | Distillates (petroleum), hydrodesulfurised intermediate catalytic cracked |
|
| | Distillates (petroleum), hydrodesulfurised heavy catalytic cracked |
|
| | Fuel oil, residues-straight-run gas oils, high-sulfur |
|
| |
| | Residues (petroleum), catalytic reformer fractionator residue distillation |
|
| | Residues (petroleum), heavy coker gas oil and vacuum gas oil |
|
| | Residues (petroleum), heavy coker and light vacuum |
|
| | Residues (petroleum), light vacuum |
|
| | Residues (petroleum), steam-cracked light |
|
| |
| | Residues (petroleum), topping plant, low-sulfur |
|
| | Gas oils (petroleum), heavy atmospheric |
|
| | Residues (petroleum), coker scrubber, condensed-ring-aromatic-contg |
|
| | Distillates (petroleum), petroleum residues vacuum |
|
| | Residues (petroleum), steam-cracked, resinous |
|
| | Distillates (petroleum), intermediate vacuum |
|
| | Distillates (petroleum), light vacuum |
|
| | Distillates (petroleum), vacuum |
|
| | Gas oils (petroleum), hydrodesulfurised coker heavy vacuum |
|
| | Residues (petroleum), steam-cracked, distillates |
|
| | Residues (petroleum), vacuum, light |
|
| | Fuel oil, heavy, high-sulfur |
|
| | Residues (petroleum), catalytic cracking |
|
| | Distillates (petroleum), intermediate catalytic cracked, thermally degraded |
|
| | Residual oils (petroleum) |
|
| | Residues, steam cracked, thermally treated |
|
| | Distillates (petroleum), hydrodesulfurised full-range middle |
|
| | Distillates (petroleum), light paraffinic |
|
| | Distillates (petroleum), heavy paraffinic |
|
| | Distillates (petroleum), light naphthenic |
|
| | Distillates (petroleum), heavy naphthenic |
|
| | Distillates (petroleum), acid-treated heavy naphthenic |
|
| | Distillates (petroleum), acid-treated light naphthenic |
|
| | Distillates (petroleum), acid-treated heavy paraffinic |
|
| | Distillates (petroleum), acid-treated light paraffinic |
|
| | Distillates (petroleum), chemically neutralised heavy paraffinic |
|
| | Distillates (petroleum), chemically neutralised light paraffinic |
|
| | Distillates (petroleum), chemically neutralised heavy naphthenic |
|
| | Distillates (petroleum), chemically neutralised light naphthenic |
|
| | Extracts (petroleum), light naphthenic distillate solvent |
|
| | Extracts (petroleum), heavy paraffinic distillate solvent |
|
| | Extracts (petroleum), light paraffinic distillate solvent |
|
| | Extracts (petroleum), heavy naphthenic distillate solvent |
|
| | Extracts (petroleum), light vacuum gas oil solvent |
|
| | Hydrocarbons, C26-55, aromatic-rich |
|
| | Disodium 3,3’-[[1,1’-biphenyl]-4,4’-diylbis(azo)]bis(4-aminonaphthalene-1-sulphonate) |
|
| | Disodium 4-amino-3-[[4’-[(2,4-diaminophenyl)azo] [1,1’-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)naphthalene-2,7-disulphonate |
|
| | Tetrasodium 3,3’-[[1,1’-biphenyl]-4,4’-diylbis(azo)]bis[5-amino-4-hydroxynaphthalene-2,7-disulphonate] |
|
| |
| |
| | Disodium[5-[[4’-[[2,6-dihydroxy-3-[(2-hydroxy-5-sulphophenyl)azo]phenyl]azo][1,1’-biphenyl]-4-yl]azo]salicylato(4-)]cuprate(2-) |
|
| | Resorcinol diglycidyl ether |
|
| |
| |
| |
| |
| |
| |
| |
| | 2-(2-Methoxyethoxy)ethanol |
|
| | (+/-)-2-(2,4-Dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propyl-1,1,2,2-tetrafluoroethylether |
|
| | 4-[4-(1,3-Dihydroxyprop-2-yl)phenylamino]-1,8-dihydroxy-5-nitroanthraquinone |
|
| | 5,6,12,13-Tetrachloroanthra(2,1,9-def:6,5,10-d’e’f’)diisoquinoline-1,3,8,10 (2H,9H)-tetrone |
|
| | Tris(2-Chloroethyl) phosphate |
|
| | 4’-Ethoxy-2-benzimidazoleanilide |
|
| |
| |
| |
| | Bis(cyclopentadienyl)-bis(2,6-difluoro-3-(pyrrol-1-yl)-phenyl) titanium |
|
| | N,N,N’,N’-Tetraglycidyl-4,4’-diamino-3,3’-diethyldiphenylmethane |
|
| |
| | Alkali salts of pentachlorophenol |
|
| |
| | N-(Trichloromethylthio)phthalimide |
|
| |
| |
| | 1-Bromo-3,4,5-trifluorobenzene |
|
| |
| | 3-(4-Chlorophenyl)-1,1-dimethyluronium trichloroacetate; monuron-TCA |
|
| |
| |
| |
| |
| | 2-Ethylhexanoic acid and its salts |
|
| |
| | Morpholine-4-carbonyl chloride |
|
| |
| |
| | UVCB condensation product of: tetrakis-hydroxymethylphosphonium chloride, urea and distilled hydrogenated C16-18 tallow alkylamine |
|
| |
| | 3,5-Dibromo-4-hydroxybenzonitrile |
|
| | 2,6-Dibromo-4-cyanophenyl octanoate |
|
| | [4-[[4-(Dimethylamino)phenyl][4-[ethyl(3-sulphonatobenzyl)amino]phenyl] methylene]cyclohexa-2,5-dien-1-ylidene](ethyl)(3-sulphonatobenzyl)ammonium, sodium salt |
|
| | 5-Chloro-1,3-dihydro-2H-indol-2-one |
|
| |
| |
| | N’-(4-Chloro-o-tolyl)-N,N-dimethylformamidine monohydrochloride |
|
| | 4,4’-Methylenebis(2-ethylaniline) |
|
| |
| | [(p-Tolyloxy)methyl]oxirane |
|
| | [(m-Tolyloxy)methyl]oxirane |
|
| | 2,3-Epoxypropyl o-tolyl ether |
|
| | [(Tolyloxy)methyl]oxirane, cresyl glycidyl ether |
|
| |
| | Benzyl 2,4-dibromobutanoate |
|
| |
| |
| | Dodecachloropentacyclo[5.2.1.02,6.03,9.05,8]decane |
|
| |
| |
| |
| |
| | (R)-α-Phenylethylammonium (-)-(1R,2S)-(1,2-epoxypropyl) phosphonate monohydrate |
|
| | 5-Ethoxy-3-trichloromethyl-1,2,4-thiadiazole |
|
| |
| |
| |
| |
| |
| |
| | 3-(4-Isopropylphenyl)-1,1-dimethylurea |
|
| |
| | 4-Cyano-2,6-diiodophenyl octanoate |
|
| | 5-(2,4-Dioxo-1,2,3,4-tetrahydropyrimidine)-3-fluro-2-hydroxymethyltetrahydrofuran |
|
| |
| | Hexahydrocyclopenta(c)pyrrole-1-(1H)-ammonium N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanide |
|
| | 4,4’-Carbonimidoylbis[N,N-dimethylaniline] and its salts |
|
| |
| |
| |
| | 2-(4-tert-Butylphenyl)ethanol |
|
| |
| |
| |
| |
| |
| | N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide |
|
| |
| | 4,4’-Isobutylethylidenediphenol |
|
| |
| |
| |
| | Distillates (petroleum), light hydrocracked |
|
| | 1-Ethyl-1-methylmorpholinium bromide |
|
| | (3-Chlorophenyl)-(4-methoxy-3-nitrophenyl)methanone |
|
| | Fuels, diesel, except if the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen |
|
| |
| |
| |
| | 2,2-Dibromo-2-nitroethanol |
|
| | 1-Ethyl-1-methylpyrrolidinium bromide |
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | 3,5,5-Trimethylcyclohex-2-enone |
|
| |
| |
| | (S)-2,3-Dihydro-1H-indole-carboxylic acid |
|
| |
| | (4-Hydrazinophenyl)-N-methylmethanesulfonamide hydrochloride |
|
| | Colouring agent Solvent Yellow No. 14 |
|
| |
| |
| |
| |
| | Diethylcarbamoyl-chloride |
|
| |
| | Myclobutanil; 2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile |
|
| |
| |
| | trans-4-Cyclohexyl-L-proline monohydro-chloride |
|
| | 2-Methyl-m-phenylene diisocyanate |
|
| | 4-Methyl-m-phenylene diisocyanate |
|
| | m-Tolylidene diisocyanate |
|
| | Fuels, jet aircraft, coal solvent extraction, hydrocracked hydrogenated |
|
| | Fuels, diesel, coal solvent extraction, hydrocracked hydrogenated |
|
| | Pitch, if it contains > 0.005% w/w benzo[a]pyrene |
|
| |
| | Hydrocarbons, C16-20, solvent-dewaxed hydrocracked paraffinic distillation residue |
|
| |
| | Mineral wool, with the exception of those listed elsewhere in this Part; [Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O + K2O + CaO + MgO + BaO) content greater than 18% by weight] |
|
| | Reaction product of acetophenone, formaldehyde, cyclohexylamine, methanol and acetic acid |
|
| | Trisodium bis(7-acetamido-2-(4-nitro-2-oxidophenylazo)-3-sulfonato-1-naphtholato)chromate(1-) |
|
| | A mixture of: 4-allyl-2,6-bis(2,3-epoxypropyl)phenol; 4-allyl-6-[3-[6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)-phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)-phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol; 4-allyl-6-[3-(4-allyl-2,6-bis-(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-2-(2,3-epoxypropyl) phenol; 4-allyl-6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)-phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol |
|
| | Costus root oil (Saussurea lappa Clarke), when used as a fragrance ingredient |
|
| | 7-Ethoxy-4-methylcoumarin, when used as a fragrance ingredient |
|
| | Hexahydrocoumarin, when used as a fragrance ingredient |
|
| | Exudation of Myroxylon pereirae (Royle) Klotzsch (Peru balsam, crude), when used as a fragrance ingredient |
|
| |
| | Isoprene (stabilised); (2-Methyl-1,3-butadiene) |
|
| | 1-Bromopropane; n-Propyl bromide |
|
| | Chloroprene (stabilised) (2-Chlorobuta-1,3-diene) |
|
| |
| | Ethylene glycol dimethyl ether (EGDME) |
|
| |
| | Diaminotoluene, technical product-mixture of [4-methyl-m-phenylene diamine]2 and [2-methyl-m-phenylene diamine]3 methyl-phenylenediamine |
|
| |
| | Diphenylether; Octabromo derivate |
|
| | 1,2-bis(2-methoxyethoxy)ethane Triethylene glycol dimethyl ether; (TEGDME) |
|
| | Tetrahydrothiopyran-3-carboxaldehyde |
|
| | 4,4’-bis(dimethylamino)benzophenone (Michler’s ketone) |
|
| | Oxiranemethanol, 4-methylbenzene-sulfonate, (S) |
|
| | 1,2-Benzenedicarboxylic acid, dipentylester, branched and linear; n-Pentylisopentylphthalate; di-n-Pentyl phthalate; Diisopentylphthalate |
|
| | Benzyl butyl phthalate (BBP) |
|
| | 1,2-Benzenedicarboxylic acid, di-C-7-11- branched and linear alkyl esters |
|
| | A mixture of: Disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl) penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl) benzenesulfonate, and trisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-xido-1-(4-sulfonatophenyl)pyrazol-4-yl) penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl) benzenesulfonate |
|
| | (Methylenebis(4,1-phenylenazo(1-(3-(dimethylamino)-propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3diyl)))-1,1’-dipyridinium dichloride dihydrochloride |
|
| | 2-[2-Hydroxy-3-(2-chlorophenyl)-carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo] fluoren-9-one |
|
| |
| | 2,4,5-Trimethylaniline; 2,4,5-trimethylaniline hydrochloride |
|
| | 4,4’-Thiodianiline and its salts |
|
| | 4,4’-Oxydianiline (p-aminophenyl ether) and its salts |
|
| | N,N,N’,N’-Tetramethyl-4,4’-methylendianiline |
|
| | 6-Methoxy-m-toluidine; (p-Cresidine) |
|
| | 3-Ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine |
|
| | A mixture of: 1,3,5-Tris(3-Aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione, and a mixture of oligomers of 3,5-bis(3-Aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione |
|
| |
| |
| |
| | Nonylphenol, 4-Nonylphenol, branched |
|
| |
| |
| | Vinylidene chloride (1,1-Dichloroethylene) |
|
| | Allyl chloride (3-Chloropropene) |
|
| | 1,4-Dichlorobenzene (p-Dichlorobenzene) |
|
| |
| |
| | Bisphenol A (4,4’-Isopropylidenediphenol) |
|
| | Trioxymethylene (1,3,5-Trioxan) |
|
| |
| |
| |
| |
| |
| | N,N-Dimethylanilinium tetrakis(pentafluorophenyl)borate |
|
| | O,O’-(Ethenylmethylsilylene) di[(4-methylpentan-2-one)-oxime] |
|
| | A 2:1 mixture of: 4-(7-Hydroxy-2,4,4-trimethyl-2-chromanyl) resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalene-1-sulfonate), and 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)-resorcinol-bis(6-diazo-5,6-dihydro-5-oxonaphthalene-1-sulfonate) |
|
| | A mixture of: reaction product of 4,4’-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:2) and reaction product of 4,4’-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxonaphthalenesulfonate (1:3) |
|
| | Malachite green hydrochloride; Malachite green oxalate |
|
| | 1-(4-Chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl) pentan-3-ol |
|
| | 5-(3-Butyryl-2,4,6-trimethylphenyl)-2-[1-(ethoxyimino) propyl]-3-hydroxycyclohex-2-en-1-one |
|
| |
| | Bromoxynil heptanoate (ISO) |
|
| | A mixture of: 5-[(4-[(7-Amino-1-hydroxy-3-sulfo-2-naphthyl) azo]-2,5-diethoxyphenyl)azo]-2-[(3-phosphonophenyl)azo]-benzoic acid, and 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)-azo]-2,5-diethoxyphenyl)azo]-3-[(3-phosphonophenyl)azo]benzoic acid |
|
| | 2-{4-(2-Ammoniopropylamino)-6-[4-hydroxy-3-(5-methyl-2-methoxy-4-sulfamoylphenylazo)-2-sulfonatonaphth-7ylamino]-1,3,5-triazin-2-ylamino}-2-aminopropyl formate |
|
| | 5-Nitro-o-toluidine; 5-Nitro-o-toluidine hydrochloride |
|
| | 1-(1-Naphthylmethyl)quinolinium chloride |
|
| | (R)-5-Bromo-3-(1-methyl-2-pyrrolidinyl methyl)-1H-indole |
|
| |
| |
| | Chlorotoluron; (3-(3-Chloro-p-tolyl)-1,1-dimethylurea) |
|
| | N-[2-(3-Acetyl-5-nitrothiophen-2-ylazo)-5-diethylaminophenyl] acetamide |
|
| | 1,3-bis(vinylsulfonylacetamido)-propane |
|
| | p-Phenetidine; (4-Ethoxyaniline) |
|
| | m-Phenylenediamine and its salts |
|
| | Residues (coal tar), creosote oil distillation, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Creosote oil, acenaphthene fraction, wash oil, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Creosote oil, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Creosote, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Creosote oil, high-boiling distillate, wash oil, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Extract residues (coal), creosote oil acid, wash oil extract residue, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | Creosote oil, low-boiling distillate, wash oil, if it contains > 0.005% w/w benzo[a]pyrene |
|
| | 6-Methoxy-2,3-pyridinediamine and its HCl salt, when used as a substance in hair dye products |
|
| | 2,3-Naphthalenediol, when used as a substance in hair dye products |
|
| | 2,4-Diaminodiphenylamine, when used as a substance in hair dye products |
|
| | 2,6-bis(2-hydroxyethoxy)-3,5-pyridinediamine and its HCl salt, when used as a substance in hair dye products |
|
| | 2-Methoxymethyl-p-aminophenol and its HCl salt, when used as a substance in hair dye products |
|
| | 4,5-Diamino-1-methylpyrazole and its HCl salt, when used as a substance in hair dye products |
|
| | 4,5-Diamino-1-((4-chlorophenyl)methyl)-1H-pyrazole sulfate, when used as a substance in hair dye products |
|
| | 4-Chloro-2-aminophenol, when used as a substance in hair dye products |
|
| | 4-Hydroxyindole, when used as a substance in hair dye products |
|
| | 4-Methoxytoluene-2,5-diamine and its HCl salt, when used as a substance in hair dye products |
|
| | 5-Amino-4-fluoro-2-methylphenol sulfate, when used as a substance in hair dye products |
|
| | N,N-Diethyl-m-aminophenol, when used as a substance in hair dye products |
|
| | N,N-Dimethyl-2,6-pyridinediamine and its HCl salt, when used as a substance in hair dye products |
|
| | N-Cyclopentyl-m-aminophenol, when used as a substance in hair dye products |
|
| | N-(2-Methoxyethyl)-p-phenylenediamine and its HCl salt, when used as a substance in hair dye products |
|
| | 2,4-Diamino-5-methylphenetol and its HCl salt, when used as a substance in hair dye products |
|
| | 1,7-Naphthalenediol, when used as a substance in hair dye products |
|
| | 3,4-Diaminobenzoic acid, when used as a substance in hair dye products |
|
| | 2-Aminomethyl-p-aminophenol and its HCl salt, when used as a substance in hair dye products |
|
| | Solvent Red No. 1 (colouring agent CI 12150), when used as a substance in hair dye products |
|
| | Acid Orange No. 24 (colouring agent CI 20170), when used as a substance in hair dye products |
|
| | Acid Red No. 73 (colouring agent CI 27290), when used as a substance in hair dye products |
|
| | PEG-3,2’,2’-di-p-phenylenediamine |
|
| |
| |
| |
| |
| | HC Red No. 8 and its salts |
|
| | Tetrahydro-6-nitroquinoxaline and its salts |
|
| | Disperse Red No. 15, except as impurity in Disperse Violet No. 1 |
|
| |
| | N,N’-Dihexadecyl-N,N’-bis(2-hydroxyethyl)propanediamide; Bishydroxyethyl Biscetyl Malonamide |
|
| | 1-Methyl-2,4,5-trihydroxybenzene and its salts, when used as a substance in hair dye products |
|
| | 2,6-Dihydroxy-4-methylpyridine and its salts, when used as a substance in hair dye products |
|
| | 5-Hydroxy-1,4-benzodioxane and its salts, when used as a substance in hair dye products |
|
| | 3,4-Methylenedioxyphenol and its salts, when used as a substance in hair dye products |
|
| | 3,4-Methylenedioxyaniline and its salts, when used as a substance in hair dye products |
|
| | Hydroxypyridinone and its salts, when used as a substance in hair dye products |
|
| | 3-Nitro-4-aminophenoxyethanol and its salts, when used as a substance in hair dye products |
|
| | 2-Methoxy-4-nitrophenol (4-Nitroguaiacol) and its salts, when used as a substance in hair dye products |
|
| | Colouring agent Acid Black No. 131 and its salts, when used as a substance in hair dye products |
|
| | 1,3,5-Trihydroxybenzene (Phloroglucinol) and its salts, when used as a substance in hair dye products |
|
| | 1,2,4-Benzentriacetate and its salts, when used as a substance in hair dye products |
|
| | Ethanol, 2,2’-iminobis-, reaction products with epichlorohydrin and 2-nitro-1,4-benzenediamine (HC Blue No. 5) and its salts, when used as a substance in hair dye products |
|
| | N-Methyl-1,4-diaminoanthraquinone, reaction products with epichlorohydrin and monoethanolamine (HC Blue No. 4) and its salts, when used as a substance in hair dye products |
|
| | 4-Aminobenzenesulfonic acid and its salts, when used as a substance in hair dye products |
|
| | 3,3’-(Sulfonylbis(2-nitro-4,1-phenylene)imino)bis(6-(phenylamino)) benzenesulfonic acid and its salts, when used as a substance in hair dye products |
|
| | 3(or 5)-((4-(Benzylmethylamino)phenyl)azo)-1,2-(or 1,4)-dimethyl-1H-1,2,4-triazolium and its salts, when used as a substance in hair dye products |
|
| | 2,2’-((3-Chloro-4-((2,6-dichloro-4-nitrophenyl)azo)phenyl)imino)bisethanol (Disperse Brown No. 1) and its salts, when used as a substance in hair dye products |
|
| | Benzothiazolium, 2-[[4-[ethyl(2-hydroxyethyl)amino]phenyl] azo]-6-methoxy-3-methyl and its salts, when used as a substance in hair dye products |
|
| | 2-[(4-Chloro-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxobutanamide (Pigment Yellow No. 73) and its salts, when used as a substance in hair dye products |
|
| | 2,2’-[(3,3’-dichloro[1,1’biphenyl]-4,4’-diyl)bis(azo)]bis[3-oxo-N-phenylbutanamide] (Pigment Yellow No. 12) and its salts, when used as a substance in hair dye products |
|
| | 2,2’(1,2-Ethenediyl)bis[5-((4-ethoxyphenyl)azo] benzenesulfonic acid) and its salts, when used as a substance in hair dye products |
|
| | 2,3-Dihydro-2,2-dimethyl-6-[(4-(phenylazo)-1-naphthelenyl) azo]-1H-pyrimidine (Solvent Black No. 3) and its salts, when used as a substance in hair dye products |
|
| | 3(or 5)-[[4-[(7-amino-1-hydroxy-3-sulphonato-2-naphthyl)azo]-1-naphthyl]azo]salicylic acid and its salts, when used as a substance in hair dye products |
|
| | 2-Naphthalenesulfonic acid, 7-(benzoylamino)-4-hydroxy-3-[[4-[(4-sulfophenyl)azo]phenyl]azo]- and its salts, when used as a substance in hair dye products |
|
| (micro-((7,7’-Iminobis(4-hydroxy-3-((2-hydroxy-5-(N-methylsulphamoyl)phenyl)azo)naphthalene-2-sulphonato)) (6-)))dicuprate and its salts, when used as a substance in hair dye products |
|
| | 3-[(4-(Acetylamino)phenyl)azo]-4-hydroxy-7-[[[[5-hydroxy-6-(phenylazo)-7-sulfo-2-naphthalenyl] amino]carbonyl]amino]-2-naphthalenesulfonic acid and its salts, when used as a substance in hair dye products |
|
| | 2-Naphthalenesulfonic acid, 7,7’-(carbonyldiimino)bis(4-hydroxy-3-[[2-sulfo-4-[(4-sulfophenyl)azo] phenyl]azo] and its salts, when used as a substance in hair dye products |
|
| | Ethanaminium, N-(4-[bis[4-(diethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene)-N-ethyl- and its salts, when used as a substance in hair dye products |
|
| | 3H-Indolium, 2-[[(4-methoxyphenyl)methylhydrazono]methyl]-1,3,3-trimethyl- and its salts, when used as a substance in hair dye products |
|
| | 3H-Indolium, 2-(2-((2,4-dimethoxyphenyl)amino)ethenyl)-1,3,3-trimethyl- and its salts, when used as a substance in hair dye products |
|
| | Nigrosine spirit soluble (Solvent Black No. 5), when used as a substance in hair dye products |
|
| | Phenoxazin-5-ium, 3,7-bis(diethylamino)-, and its salts, when used as a substance in hair dye products |
|
| | Benzo[a]phenoxazin-7-ium, 9-(dimethylamino)-, and its salts, when used as a substance in hair dye products |
|
| | 6-Amino-2-(2,4-dimethylphenyl)-1H-benz[de]isoquinoline-1,3(2H)-dione (Solvent Yellow No. 44) and its salts, when used as a substance in hair dye products |
|
| | 1-Amino-4-[[4-[(dimethylamino)methyl]phenyl]amino] anthraquinone and its salts, when used as a substance in hair dye products |
|
| | Laccaic Acid (colouring agent Natural Red No. 25) and its salts, when used as a substance in hair dye products |
|
| | Benzenesulfonic acid, 5-[(2,4-dinitrophenyl)amino]-2-(phenylamino)-, and its salts, when used as a substance in hair dye products |
|
| | 4-[(4-Nitrophenyl)azo]aniline (Disperse Orange No. 3) and its salts, when used as a substance in hair dye products |
|
| | 4-Nitro-m-phenylenediamine and its salts, when used as a substance in hair dye products |
|
| | 1-Amino-4-(methylamino)-9,10-anthracenedione (Disperse Violet No. 4) and its salts, when used as a substance in hair dye products |
|
| | N-Methyl-3-nitro-p-phenylenediamine and its salts, when used as a substance in hair dye products |
|
| | N1-(2-Hydroxyethyl)-4-nitro-o-phenylenediamine (HC Yellow No. 5) and its salts, when used as a substance in hair dye products |
|
| | N1-(Tris(hydroxymethyl))methyl-4-nitro-1,2-phenylenediamine (HC Yellow No. 3) and its salts, when used as a substance in hair dye products |
|
| | 2-Nitro-N-hydroxyethyl-p-anisidine and its salts, when used as a substance in hair dye products |
|
| | N,N’-Dimethyl-N-Hydroxyethyl-3-nitro-p-phenylenediamine and its salts, when used as a substance in hair dye products |
|
| | 3-(N-Methyl-N-(4-methylamino-3-nitrophenyl)amino)propane-1,2-diol and its salts, when used as a substance in hair dye products |
|
| | 4-Ethylamino-3-nitrobenzoic acid (N-Ethyl-3-Nitro PABA) and its salts, when used as a substance in hair dye products |
|
| | (8-[(4-Amino-2-nitrophenyl)azo]-7-hydroxy-2 naphthyl) trimethylammonium and its salts (except Basic Red No. 118 as impurity in Basic Brown No. 17), when used as a substance in hair dye products |
|
| | 5-((4-(Dimethylamino)phenyl)azo)-1,4-dimethyl-1H-1,2,4-triazolium and its salts, when used as a substance in hair dye products |
|
| | m-Phenylenediamine, 4-(phenylazo)- and its salts, when used as a substance in hair dye products |
|
| | 1,3-Benzenediamine, 4-methyl-6-(phenylazo)- and its salts, when used as a substance in hair dye products |
|
| | 2,7-Naphthalenedisulfonic acid, 5-(acetylamino)-4-hydroxy-3-((2-methylphenyl)azo)- and its salts, when used as a substance in hair dye products |
|
| | 4,4’-[(4-Methyl-1,3-phenylene)bis(azo)]bis[6-methyl-1,3-benzenediamine] (Basic Brown No. 4) and its salts, when used as a substance in hair dye products |
|
| | Benzenaminium, 3-[[4-[[diamino(phenylazo)phenyl]azo]-2-methylphenyl]azo]-N,N,N-trimethyl- and its salts, when used as a substance in hair dye products |
|
| | Benzenaminium, 3-[[4-[[diamino(phenylazo)phenyl]azo]-1-naphthalenyl]azo]-N,N,N-trimethyl and its salts, when used as a substance in hair dye products |
|
| | Ethanaminium, N-(4-[(4-(diethylamino)phenyl) phenylmethylene]-2,5-cyclohexadien-1-ylidene)-N-ethyl- and its salts, when used as a substance in hair dye products |
|
| | 9,10-Anthracenedione, 1-[(2-hydroxyethyl)amino]-4-(methylamino) and its derivatives and salts, when used as a substance in hair dye products |
|
| | 1,4-Diamino-2-methoxy-9,10-anthracenedione (Disperse Red No. 11) and its salts, when used as a substance in hair dye products |
|
| | 1,4-Dihydroxy-5,8-bis[(2-hydroxyethyl)amino]anthraquinone (Disperse Blue No. 7) and its salts, when used as a substance in hair dye products |
|
| | 1-[(3-Aminopropyl)amino]-4-(methylamino)anthraquinone and its salts, when used as a substance in hair dye products |
|
| | N-[6-[(2-Chloro-4-hydroxyphenyl)imino]-4-methoxy-3-oxo-1,4-cyclohexadien-1-yl]acetamide (HC Yellow No. 8) and its salts, when used as a substance in hair dye products |
|
| | [6-[[3-Chloro-4-(methylamino)phenyl]imino]-4-methyl-3-oxocyclohexa-1,4-dien-1-yl]urea (HC Red No. 9) and its salts, when used as a substance in hair dye products |
|
| | Phenothiazin-5-ium, 3,7-bis(dimethylamino)- and its salts, when used as a substance in hair dye products |
|
| | 4,6-bis(2-hydroxyethoxy)-m-phenylenediamine and its salts, when used as a substance in hair dye products |
|
| | 5-Amino-2,6-dimethoxy-3-hydroxypyridine and its salts, when used as a substance in hair dye products |
|
| | 4,4’-Diaminodiphenylamine and its salts, when used as a substance in hair dye products |
|
| | 4-Diethylamino-o-toluidine and its salts, when used as a substance in hair dye products |
|
| | N,N-Diethyl-p-phenylenediamine and its salts, when used as a substance in hair dye products |
|
| | N,N-Dimethyl-p-phenylenediamine and its salts, when used as a substance in hair dye products |
|
| | Toluene-3,4-diamine and its salts, when used as a substance in hair dye products |
|
| | 2,4-Diamino-5-methylphenoxyethanol and its salts, when used as a substance in hair dye products |
|
| | 6-Amino-o-cresol and its salts, when used as a substance in hair dye products |
|
| | Hydroxyethylaminomethyl-p-aminophenol and its salts, when used as a substance in hair dye products |
|
| | 2-Amino-3-nitrophenol and its salts, when used as a substance in hair dye products |
|
| | 2-Chloro-5-nitro-N-hydroxyethyl-p-phenylenediamine and its salts, when used as a substance in hair dye products |
|
| | 2-Nitro-p-phenylenediamine and its salts, when used as a substance in hair dye products |
|
| | Hydroxyethyl-2,6-dinitro-p-anisidine and its salts, when used as a substance in hair dye products |
|
| | 6-Nitro-2,5-pyridinediamine and its salts, when used as a substance in hair dye products |
|
| | Phenazinium, 3,7-diamino-2,8-dimethyl-5-phenyl- and its salts, when used as a substance in hair dye products |
|
| | 3-Hydroxy-4-[(2-hydroxynaphthyl)azo]-7-nitronaphthalene-1-sulphonic acid and its salts, when used as a substance in hair dye products |
|
| | 3-[(2-nitro-4-(trifluoromethyl)phenyl)amino]propane-1,2-diol (HC Yellow No. 6) and its salts, when used as a substance in hair dye products |
|
| | 2-[(4-chloro-2-nitrophenyl)amino]ethanol (HC Yellow No. 12) and its salts, when used as a substance in hair dye products |
|
| | 3-[[4-[(2-Hydroxyethyl)Methylamino]-2-Nitrophenyl]amino]-1,2-propanediol and its salts, when used as a substance in hair dye products |
|
| | 3-[[4-[(2-Hydroxyethyl)amino]-2-nitrophenyl]amino]-1,2-propanediol and its salts, when used as a substance in hair dye products |
|
| | Ethanaminium, N-[4-[[4-(diethylamino)phenyl][4-(ethylamino)-1-naphthalenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl- and its salts, when used as a substance in hair dye products |
|
| | 4-[(4-Aminophenyl)(4-iminocyclohexa-2,5-dien-1-ylidene) methyl]-o-toluidine and its hydrochloride salt (Basic Violet No. 14; colouring agent CI 42510), when used as a substance in hair dye products |
|
| | 4-(2,4-Dihydroxyphenylazo)benzene sulphonic acid and its sodium salt (Acid Orange No. 6; colouring agent CI 14270), when used as a substance in hair dye products |
|
| | 3-Hydroxy-4-(phenylazo)-2-naphthoic acid and its calcium salt (Pigment Red No. 64:1; colouring agent CI 15800), when used as a substance in hair dye products |
|
| | 2-(6-Hydroxy-3-oxo-(3H)-xanthen-9-yl)benzoic acid; Fluorescein and its disodium salt (Acid Yellow No. 73 sodium salt; colouring agent CI 45350), when used as a substance in hair dye products |
|
| | 4’,5’-Dibromo-3’,6’-dihydroxyspiro[isobenzofuran-1(3H),9’-[9H]xanthene]-3-one; 4’,5’-Dibromofluorescein; (Solvent Red No. 72) and its disodium salt (colouring agent CI 45370), when used as a substance in hair dye products |
|
| | 2-(3,6-Dihydroxy-2,4,5,7-tetrabromoxanthen-9-yl)-benzoic acid; Fluorescein, 2’,4’,5’,7’-tetrabromo-; (Solvent Red No. 43) and its disodium salt (Acid Red No. 87; colouring agent CI 45380) and its aluminium salt (Pigment Red No. 90:1 Aluminium lake), when used as a substance in hair dye products |
|
| | Xanthylium, 9-(2-carboxyphenyl)-3-((2-methylphenyl)amino)-6-((2-methyl-4-sulfophenyl)amino)-, inner salt and its sodium salt (Acid Violet No. 9; colouring agent CI 45190), when used as a substance in hair dye products |
|
| | 3’,6’-Dihydroxy-4’,5’-diiodospiro(isobenzofuran-1(3H),9’-[9H] xanthene)-3-one; (Solvent Red No. 73) and its sodium salt (Acid Red No. 95; colouring agent CI 45425), when used as a substance in hair dye products |
|
| | 2’,4’,5’,7’-Tetraiodofluorescein, its disodium salt (Acid Red No. 51; colouring agent CI 45430) and its aluminium salt (Pigment Red No. 172 Aluminium lake), when used as a substance in hair dye products |
|
| | 1-Hydroxy-2,4-diaminobenzene (2,4-Diaminophenol) and its dihydrochloride salts (2,4-Diaminophenol HCl), when used as a substance in hair dye products |
|
| | 1,4-Dihydroxybenzene (Hydroquinone), with the exception of reference number 14, Part II |
|
| | [4-[[4-Anilino-1-naphthyl][4-dimethylamino)phenyl]methylene] cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride (Basic Blue No. 26; colouring agent CI 44045), when used as a substance in hair dye products |
|
| | Disodium 3-[(2,4-dimethyl-5-sulphonatophenyl)azo]-4-hydroxynaphthalene-1-sulphonate (Ponceau SX; colouring agent CI 14700), when used as a substance in hair dye products |
|
| | Trisodium tris[5,6-dihydro-5-(hydroxyimino)-6-oxonaphthalene-2-sulphonate(2-)-N5,O6]ferrate(3-); (Acid Green No. 1; colouring agent CI 10020), when used as a substance in hair dye products |
|
| | 4-(Phenylazo)resorcinol (Solvent Orange No. 1; colouring agent CI 11920) and its salts, when used as a substance in hair dye products |
|
| | 4-[(4-Ethoxyphenyl)azo]naphthol (Solvent Red No. 3; colouring agent CI 12010) and its salts, when used as a substance in hair dye products |
|
| | 1-[(2-Chloro-4-nitrophenyl)azo]-2-naphthol (Pigment Red No. 4; colouring agent CI 12085) and its salts, when used as a substance in hair dye products |
|
| | 3-Hydroxy-N-(o-tolyl)-4-[(2,4,5-trichlorophenyl)azo] naphthalene-2-carboxamide (Pigment Red No. 112; CI 12370) and its salts, when used as a substance in hair dye products |
|
| | N-(5-Chloro-2,4-dimethoxyphenyl)-4-[[5-[(diethylamino) sulphonyl]-2-methoxyphenyl]azo]-3-hydroxynaphthalene-2-carboxamide (Pigment Red No. 5; colouring agent CI 12490) and its salts, when used as a substance in hair dye products |
|
| | Disodium 4-[(5-chloro-4-methyl-2-sulphonatophenyl)azo]-3-hydroxy-2-naphthoate (Pigment Red No. 48; colouring agent CI 15865), when used as a substance in hair dye products |
|
| | Calcium 3-hydroxy-4-[(1-sulphonato-2-naphthyl)azo]-2-naphthoate (Pigment Red No. 63:1; colouring agent CI 15880), when used as a substance in hair dye products |
|
| | Trisodium 3-hydroxy-4-(4’-sulphonatonaphthylazo) naphthalene-2,7-disulphonate (Acid Red No. 27; colouring agent CI 16185), when used as a substance in hair dye products |
|
| | 2,2’-[(3,3’-Dichloro[1,1’-biphenyl]-4,4’-diyl)bis(azo)]bis[N-(2,4-dimethylphenyl)-3-oxobutyramide] (Pigment Yellow No. 13; colouring agent CI 21100), when used as a substance in hair dye products |
|
| | 2,2’-[Cyclohexylidenebis[(2-methyl-4,1-phenylene)azo]]bis[4-cyclohexylphenol] (Solvent Yellow No. 29; colouring agent CI 21230), when used as a substance in hair dye products |
|
| | 1-((4-Phenylazo)phenylazo)-2-naphthol (Solvent Red No. 23; colouring agent CI 26100), when used as a substance in hair dye products |
|
| | Tetrasodium 6-amino-4-hydroxy-3-[[7-sulphonato-4-[(4-sulphonatophenyl)azo]-1-naphthyl]azo]naphthalene-2,7-disulphonate (Food Black No. 2; colouring agent CI 27755), when used as a substance in hair dye products |
|
| | Ethanaminium, N-(4-((4-diethylamino)phenyl)(2,4-disulfophenyl)methylene)-2,5-cyclohexadien-1-ylidene)-N-ethyl-, hydroxide, inner salt, sodium salt (Acid Blue No. 1; colouring agent CI 42045), when used as a substance in hair dye products |
|
| | Ethanaminium, N-(4-((4-diethylamino)phenyl)(5-hydroxy-2,4-disulphophenyl)methylene)-2,5-cyclohexadien-1-ylidene)-N-ethyl-, hydroxide, inner salt, calcium salt (2:1) (Acid Blue No. 3; colouring agent CI 42051), when used as a substance in hair dye products |
|
| | Benzenemethanaminium, N-ethyl-N-(4-((4-(ethyl((3-sulfophenyl)methyl)amino)phenyl)(4-hydroxy-2-sulfophenyl)methylene)-2,5-cyclohexadien-1-ylidene)-3-sulfo-, hydroxide, inner salt, disodium salt (Fast Green FCF; colouring agent CI 42053), when used as a substance in hair dye products |
|
| | 1,3-Isobenzofurandione, reaction products with methylquinoline and quinoline (Solvent Yellow No. 33; colouring agent CI 47000), when used as a substance in hair dye products |
|
| | Nigrosine (colouring agent CI 50420), when used as a substance in hair dye products |
|
| | 8,18-Dichloro-5,15-diethyl-5,15-dihydrodiindolo[3,2-b:3’,2’-m] triphenodioxazine (Pigment Violet No. 23; colouring agent CI 51319), when used as a substance in hair dye products |
|
| | 1,2-Dihydroxyanthraquinone (Pigment Red No. 83; colouring agent CI 58000), when used as a substance in hair dye products |
|
| | Trisodium 8-hydroxypyrene-1,3,6-trisulphonate (Solvent Green No. 7; colouring agent CI 59040), when used as a substance in hair dye products |
|
| | 1-Hydroxy-4-(p-toluidino)anthraquinone (Solvent Violet No. 13; colouring agent CI 60725), when used as a substance in hair dye products |
|
| | 1,4-bis(p-Tolylamino)anthraquinone (Solvent Green No. 3; colouring agent CI 61565), when used as a substance in hair dye products |
|
| | 6-Chloro-2-(6-chloro-4-methyl-3-oxobenzo[b]thien-2(3H)-ylidene)-4-methylbenzo[b]thiophene-3(2H)-one (VAT Red No. 1; colouring agent CI 73360), when used as a substance in hair dye products |
|
| | 5,12-Dihydroquino[2,3-b]acridine-7,14-dione (Pigment Violet No. 19; colouring agent CI 73900), when used as a substance in hair dye products |
|
| | (29H,31H-Phthalocyaninato(2-)-N29,N30,N31,N32)copper (Pigment Blue No. 15; colouring agent CI 74160), when used as a substance in hair dye products |
|
| | Disodium [29H,31H-phthalocyaninedisulphonato(4-)-N29,N30,N31,N32]cuprate(2-) (Direct Blue No. 86; colouring agent CI 74180), when used as a substance in hair dye products |
|
| | Polychloro copper phthalocyanine (Pigment Green No. 7; colouring agent CI 74260), when used as a substance in hair dye products |
|
| | Phytonadione (INCI), phytomenadione |
|
| | 2-Aminophenol (o-Aminophenol; colouring agent CI 76520) and its salts |
|
| | N-(2-Nitro-4-aminophenyl)-allylamine (HC Red No. 16) and its salts |
|
| | Isopropyl 4-hydroxybenzoate (INCI: Isopropylparaben) Sodium salt or Salts of Isopropylparaben |
|
| | Isobutyl 4-hydroxybenzoate (INCI: Isobutylparaben) |
|
| | Sodium salt or Salts of Isobutylparaben |
|
| | Phenyl 4-hydroxybenzoate (INCI: Phenylparaben) |
|
| | Benzyl 4-hydroxybenzoate (INCI: Benzylparaben) |
|
| | Pentyl 4-hydroxybenzoate (INCI: Pentylparaben) |
|
| |
| | 3- and 4-(4-Hydroxy-4-methylpentyl) cyclohex-3-ene-1-carbaldehyde (HICC) |
|
| | 2,6-Dihydroxy-4-methyl-benzaldehyde (atranol) |
|
| | 3-Chloro-2,6-Dihydroxy-4-methyl-benzaldehyde (Chloroatranol) |
|
| | 2-chlorobenzene-1,4-diamine (2-Chloro-p-Phenylenediamine), its sulfate and dihydrochloride salts, when used as a substance in hair dye products |
|
| | Cis-1-(3-chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride (cis-CTAC) |
|
| |
| | Octamethylcyclotetrasiloxane |
|
| | 2,2’-((3,3’,5,5’-Tetramethyl-(1,1’-biphenyl)-4,4’-diyl)-bis(oxymethylene))-bis-oxirane |
|
| |
| | 1-Cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid |
|
| | N-Methyl-2-pyrrolidone; 1-methyl-2-pyrrolidone |
|
| | Diboron trioxide; boric oxide |
|
| | Sodium perborate; Sodium peroxometaborate; sodium peroxoborate |
|
| | Perboric acid, monosodium salt trihydrate; Perboric acid, sodium salt, tetrahydrate; Perboric acid, sodium salt, tetrahydrate sodium peroxoborate hexahydrate |
|
| | Perboric acid, sodium salt; Perboric acid, sodium salt, monohydrate; Perboric acid, sodium salt, monohydrate |
|
| | Dibutyltin hydrogen borate |
|
| | Nickel bis(tetrafluoroborate) |
|
| | Mancozeb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt |
|
| Maneb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) |
|
| | Benfuracarb (ISO); ethyl N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothiol]-N-isopropyl-ß-alaninate |
|
| | O-Isobutyl-N-ethoxy carbonylthiocarbamate |
|
| | Chlorpropham (ISO); isopropyl 3-chlorocarbanilate |
|
| | O-Hexyl-N-ethoxycarbonylthiocarbamate |
|
| |
| | (4-Ethoxyphenyl)(3-(4-fluoro-3-phenoxyphenyl)propyl)dimethylsilane |
|
| | Phoxim (ISO); a-(diethoxy-phosphinothioylimino)phenylacetonitrile |
|
| | Glufosinate ammonium (ISO); ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate |
|
| | Reaction mass of: dimethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; diethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; methyl ethyl(2-(hydroxymethylcarbamoyl)ethyl)phosphonate |
|
| | (4-Phenylbutyl)phosphinic acid |
|
| | Reaction mass of: 4,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 4,8-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 5,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol |
|
| | Potassium titanium oxide (K2Ti6O13) |
|
| |
| |
| |
| |
| | Nickel dinitrate; Nitric acid, nickel salt |
|
| |
| Slimes and sludges, copper electrolytic refining, decopperised, nickel sulfate |
|
| | Slimes and sludges, copper electrolyte refining, decopperised |
|
| | Nickel diperchlorate; perchloric acid, nickel(II) salt |
|
| | Nickel dipotassium bis(sulfate); Diammonium nickel bis(sulfate) |
|
| | Nickel bis(sulfamidate); nickel sulfamate |
|
| | Nickel diformate; Formic acid, nickel salt; Formic acid, copper nickel salt |
|
| | Nickel di(acetate); Nickel acetate |
|
| |
| | Nickel bis(4-cyclohexylbutyrate) |
|
| | Nickel(II) stearate; nickel(II) octadecanoate |
|
| |
| |
| | Nickel difluoride; Nickel dibromide; Nickel diiodide; Nickel potassium fluoride |
|
| | Nickel hexafluorosilicate |
|
| |
| | Nickel hydrogen phosphate; Nickel bis(dihydrogen phosphate); Trinickel bis(orthophosphate); Dinickel diphosphate; Nickel bis(phosphinate); Nickel phosphinate; Phosphoric acid, calcium nickel salt; Diphosphoric acid, nickel(II) salt |
|
| | Diammonium nickel hexacyanoferrate |
|
| |
| |
| | Nickel(II) silicate; Dinickel orthosilicate; Nickel silicate (3:4); Silicic acid, nickel salt; Trihydrogen hydroxybis[orthosilicato(4-)]trinickelate(3-) |
|
| | Dinickel hexacyanoferrate |
|
| | Trinickel bis(arsenate); nickel(II) arsenate |
|
| | Nickel oxalate; Oxalic acid, nickel salt |
|
| |
| |
| |
| | Cobalt nickel gray periclase; colouring agent CI Pigment Black 25; colouring agent CI 77332; Cobalt nickel dioxide; Cobalt nickel oxide; Nickel arsenide |
|
| | Nickel tin trioxide; nickel stannate |
|
| | Nickel triuranium decaoxide |
|
| |
| |
| |
| |
| | Silicic acid, lead nickel salt |
|
| |
| | Nickel barium titanium primrose priderite; colouring agent CI Pigment Yellow 157; colouring agent CI 77900 |
|
| | Nickel dichlorate; Nickel dibromate; Ethyl hydrogen sulfate, nickel(II) salt |
|
| | Nickel(II) trifluoroacetate |
| Nickel bis(benzenesulfonate) |
| Nickel(II) hydrogen citrate |
| Citric acid, ammonium nickel salt |
| Nickel bis(2-ethylhexanoate) |
| 2-Ethylhexanoic acid, nickel salt |
| Dimethylhexanoic acid, nickel salt |
| Neodecanoic acid, nickel salt |
| Nickel(II) neoundecanoate |
| Bis(D-gluconato-O1,O2)nickel |
| Nickel 3,5-bis(tert-butyl)-4-hydroxybenzoate (1:2) |
| (2-Ethylhexanoato-O)(isononanoato-O)nickel |
| (Isononanoato-O)(isooctanoato-O)nickel |
| (Isooctanoato-O)(neodecanoato-O)nickel |
| (2-Ethylhexanoato-O)(isodecanoato-O)nickel |
| (2-Ethylhexanoato-O)(neodecanoato-O)nickel |
| (Isodecanoato-O)(isooctanoato-O)nickel |
| (Isodecanoato-O)(isononanoato-O)nickel |
| (Isononanoato-O)(neodecanoato-O)nickel |
| Fatty acids, C6-19-branched, nickel salts |
| Fatty acids, C8-18 and C18-unsaturated, nickel salts |
| 2,7-Naphthalenedisulfonic acid, nickel(II) salt |
|
| | Nickel tellurium trioxide |
| Nickel tellurium tetraoxide |
| Molybdenum nickel hydroxide oxide phosphate |
|
| |
| | Dialuminium nickel tetraoxide |
| Nickel divanadium hexaoxide |
| Cobalt dimolybdenum nickel octaoxide |
| Nickel zirkonium trioxide |
| Molybdenum nickel tetraoxide |
| Nickel tungsten tetraoxide |
|
| | Cobalt lithium nickel oxide |
|
| |
| | Dibutyltin dichloride; (DBTC) |
|
| | 4,4’-bis(N-carbamoyl-4-methylbenzenesulfonamide)diphenylmethane |
|
| |
| | 1,2-Epoxy-4-epoxyethylcyclohexane; 4-vinylcyclohexene diepoxide |
|
| | 6-Glycidyloxynapht-1-yl oxymethyloxirane |
|
| | 2-(2-Aminoethylamino)ethanol; (AEEA) |
|
| |
| | 2,3-Epoxypropyltrimethylammonium chloride; glycidyl trimethylammonium chloride |
|
| | 1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride |
|
| | (E)-3-[1-[4-[2-(Dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
|
| | 4,4’-(1,3-Phenylene-bis(1-methylethylidene))bis-phenol |
|
| |
| | 2-Methyl-5-tert-butylthiophenol |
|
| | 2-Butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-one |
|
| | Profoxydim (ISO); 2-{(EZ)-1-[(2RS)-2-(4-chlorophenoxy)propoxyimino]butyl}-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one |
|
| | Tepraloxydim (ISO); (RS)-(EZ)-2-{1-[(2E)-3-chloroallyloxyimino]propyl}-3-hydroxy-5-perhydropyran-4-ylcyclohex-2-en-1-one |
|
| | Cyclic 3-(1,2-ethanediylacetale)-estra-5(10),9(11)-diene-3,17-dione |
|
| | Androsta-1,4,9(11)-triene-3,17-dione |
|
| | Reaction mass of: Ca salicylates (branched C10-14 and C18-30 alkylated); Ca phenates (branched C10-14 and C18-30 alkylated); Ca sulfurised phenates (branched C10-14 and C18-30 alkylated) |
|
| | 1,2-Benzenedicarboxylic acid; di-C6-8-branched alkylesters, C7-rich |
|
| | Reaction mass of: diester of 4,4’-methylenebis[2-(2-hydroxy-5-methylbenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxonaphthalene-1-sulfonic acid (1:2); triester of 4,4’-methylenebis[2-(2-hydroxy-5-methylbenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxonaphthalene-1-sulfonic acid (1:3) |
|
| | Diammonium 1-hydroxy-2-(4-(4-carboxyphenylazo)-2,5-dimethoxyphenylazo)-7-amino-3-naphthalenesulfonate |
|
| | 3-Oxoandrost-4-ene-17-ß-carboxylic acid |
|
| | (Z)-2-Methoxymino-2-[2-(tritylamino)thiazol-4-yl]acetic acid |
|
| | Trisodium nitrilotriacetate |
|
| | 2-Ethylhexyl-2-ethylhexanoate |
|
| |
| | Perfluorooctane sulfonic acid; heptadecafluorooctane-1-sulfonic acid; Potassium perfluorooctanesulfonate; potassium heptadecafluorooctane-1-sulfonate; Diethanolamine perfluorooctane sulfonate; Ammonium perfluorooctane sulfonate; ammonium heptadecafluorooctanesulfonate; Lithium perfluorooctane sulfonate; lithium heptadecafluorooctanesulfonate |
|
| | Ethyl 1-(2,4-dichlorophenyl)5-(trichloromethyl)-1H-1,2,4-triazole-3-carboxylate |
|
| | 1-Bromo-2-methylpropyl propionate |
|
| | Chloro-1-ethylcyclohexyl carbonate |
|
| | 6,6’-bis(diazo-5,5’,6,6’-tetrahydro-5,5’-dioxo)[methylene-bis(5-(6-diazo-5,6-dihydro-5-oxo-1-naphthylsulphonyloxy)-6-methyl-2-phenylene]di(naphthalene-1-sulfonate) |
|
| | Trifluralin (ISO); a,a,a-trifluoro-2,6-dinitro-N,N-dipropyl-ptoluidine; 2,6-dinitro-N,N-dipropyl-4-trifluoromethylaniline; N,N-dipropyl-2,6-dinitro-4-trifluoromethylaniline |
|
| |
| | Triammonium 4-[4-[7-(4-carboxylatoanilino)-1-hydroxy-3-sulfonato-2-naphthylazo]-2,5-dimethoxyphenylazo]benzoate |
|
| | Reaction mass of: triammonium 6-amino-3-((2,5-diethoxy-4-(3-phosphonophenyl)azo)phenyl)azo-4-hydroxy-2-naphthalenesulfonate; diammonium 3-((4-((7-amino-1-hydroxy-3-sulfo-naphthalen-2-yl)azo)-2,5-diethoxyphenyl)azo)benzoate |
|
| |
| |
| |
| |
| | Hydroxylammonium chloride; hydroxylamine hydrochloride; Bis(hydroxylammonium) sulfate; hydroxylamine sulfate (2:1) |
|
| | Diaminotoluene, methyl-phenylenediamine, technical product-reaction mass of [4-methyl-m-phenylenediamine and 2-methylm-phenylenediamine] Methyl-phenylene diamine; diaminotoluene |
|
| | Mepanipyrim; 4-methyl-N-phenyl-6-(1-propynyl)-2-pyrimidinamine |
|
| | Hydroxylammonium hydrogensulfate; hydroxylamine sulfate (1:1); Hydroxylamine phosphate; Hydroxylamine dihydrogenphosphate; Hydroxylamine 4-methylbenzenesulfonate |
|
| | (3-Chloro-2-hydroxypropyl) trimethylammonium chloride |
|
| | Biphenyl-3,3’,4,4’-tetrayltetraamine; diaminobenzidine |
|
| | Piperazine hydrochloride; Piperazine dihydrochloride; Piperazine phosphate |
|
| | 3-(Piperazin-1-yl)-benzo[d]isothiazole hydrochloride |
|
| | 2-Ethylphenylhydrazine hydrochloride |
|
| | (2-Chloroethyl)(3-hydroxypropyl)ammonium chloride |
|
| | 4-[(3-Chlorophenyl)(1H-imidazol-1-yl)methyl]-1,2-benzenediamine dihydrochloride |
|
| | Chloro-N,N-dimethylformiminium chloride |
|
| | 7-Methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one |
|
| | Reaction products of diisopropanolamine with formaldehyde(1:4) |
|
| | 3-Chloro-4-(3-fluorobenzyloxy)aniline |
|
| | Ethidium bromide; 3,8-diamino-1-ethyl-6-phenylphenantridinium bromide |
|
| | (R,S)-2-Amino-3,3-dimethylbutane amide |
|
| | 3-Amino-9-ethyl carbazole; 9-ethylcarbazol-3-ylamine |
|
| | (6R-trans)-1-((7-Ammonio-2-carboxylato-8-oxo-5-thia-1-azabicyclo-[4.2.0]oct-2-en-3-yl)methyl)pyridinium iodide |
|
| | Forchlorfenuron (ISO); 1-(2-chloro-4-pyridyl)-3-phenylurea |
|
| | Tetrahydro-1,3-dimethyl-1H-pyrimidin-2-one; dimethylpropyleneurea |
|
| |
| | Ketoconazole; 1-[4-[4-[[(2SR,4RS)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone |
|
| | Metconazole (ISO); (1RS,5RS;1RS,5SR)-5-(4-chlorobenzyl)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
|
| | Potassium 1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-ylidene)-1-propenyl]pyrazole-5-olate |
|
| | N,N’,N”-Tris(2-methyl-2,3-epoxypropyl)-perhydro-2,4,6-oxo-1,3,5-triazine |
|
| | Trimethylopropane tri(3-aziridinylpropanoate); (TAZ) |
|
| | 4,4’-Methylenediphenyl diisocyanate; diphenylmethane-4,4’-diisocyanate; 2,2’-Methylenediphenyl diisocyanate; diphenylmethane-2,2’-diisocyanate; o-(p-Isocyanatobenzyl)phenyl isocyanate; diphenylmethane-2,4’-diisocyanate; Methylenediphenyl diisocyanate |
|
| | Cinidon ethyl (ISO); ethyl (Z)-2-chloro-3-[2-chloro-5-(cyclohex-1-ene-1,2-dicarboximido)phenyl]acrylate |
|
| | N-[6,9-Dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamide |
|
| | Dimoxystrobin (ISO); (E)-2-(methoxyimino)-N-methyl-2-[a-(2,5-xylyloxy)-o-tolyl]acetamide |
|
| | N,N-(Dimethylamino)thioacetamide hydrochloride |
|
| | Reaction mass of: 2,2’-[(3,3’-dichloro[1,1’-biphenyl]-4,4’-diyl)bis(azo)]bis[N-(2,4-dimethylphenyl)]-3-oxo-butanamide; 2-[[3,3’-dichloro-4’-[[1[[(2,4-dimethylphenyl)amino]carbonyl]-2-oxopropyl]azo][1,1’-biphenyl]-4-yl]azo]-N-(2-methylphenyl)-3-oxo-butanamide; 2-[[3,3’-dichloro-4’-[[1[[(2,4-dimethylphenyl)amino]carbonyl]-2-oxopropyl]azo][1,1’-biphenyl]-4-yl]azo]-N-(2-carboxylphenyl)-3-oxo-butanamide |
|
| | Petroleum, coal, tar and natural gas and their derivatives generated using distillation and/or other processing methods if they contain ≥ 0.1% w/w benzene |
|
| | Petroleum, coal, tar and natural gas and their derivatives generated using distillation and/or other processing methods if they contain = 0.005% w/w benzo[a]pyrene |
|
| | Petroleum, coal, tar and natural gas and their derivatives generated using distillation and/or other processing methods if they contain = 0.1% w/w benzene or if they contain = 0.005% w/w benzo[a]pyrene |
|
| | Petroleum, coal, tar and natural gas and their derivatives generated using distillation and/or other processing methods if they contain ≥ 0.1% w/w 1,3-butadiene |
|
| | Tris[2-chloro-1-(chloromethyl)ethyl] phosphate |
|
| |
| |
| | Hexabromocyclododecane; 1,2,5,6,9,10-Hexabromocyclododecane |
|
| |
| | Abamectin (combination of avermectin B1a and avermectin B1b) (ISO); Avermectin B1a |
|
| |
| | Leucomalachite green; N,N,N’,N’-tetramethyl-4,4’-benzylidenedianiline |
|
| | Fuberidazole (ISO); 2-(2-furyl)-1H-benzimidazole |
|
| | Metazachlor (ISO); 2-chloro-N-(2,6-dimethylphenyl)-N-(1H-pyrazol-1-ylmethyl)acetamide |
|
| |
| |
| | 2-Ethylhexyl 10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]thio]-4-methyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate |
|
| | 2-Ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate |
|
| | Sulcotrione (ISO); 2-[2-chloro-4-(methylsulfonyl)benzoyl]cyclohexane-1,3-dione |
|
| | Bifenthrin (ISO); (2-methylbiphenyl-3-yl)methyl rel-(1R,3R)-3-[(1Z)-2-chloro-3,3,3-trifluoroprop-1-en-1-yl]-2,2-dimethylcyclopropanecarboxylate |
|
| |
| | Ammonium pentadecafluorooctanoate |
|
| |
| | N-Ethyl-2-pyrrolidone; 1-ethylpyrrolidin-2-one |
|
| | Proquinazid (ISO); 6-iodo-2-propoxy-3-propylquinazolin-4(3H)-one |
|
| |
| |
| | Aclonifen (ISO); 2-chloro-6-nitro-3-phenoxyaniline |
|
| | 2-Ethylhexyl 10-ethyl-4,4-dimethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate |
|
| |
| |
| | Tralkoxydim (ISO); 2-(N-ethoxypropanimidoyl)-3-hydroxy-5-mesitylcyclohex-2-en-1-one |
|
| | Cycloxydim (ISO); 2-(N-ethoxybutanimidoyl)-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)cyclohex-2-en-1-one |
|
| | Fluazinam (ISO); 3-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine |
|
| | Penconazole (ISO); 1-[2-(2,4-dichlorophenyl)pentyl]-1H-1,2,4-triazole |
|
| | Fenoxycarb (ISO); ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate |
|
| |
| | Tetrahydro-2-furylmethanol; tetrahydrofurfuryl alcohol |
|
| |
| |
| | Methanediol; methylene glycol |
|
| | Cymoxanil (ISO); 2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide |
|
| |
| | Tembotrione (ISO); 2-{2-chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl}cyclohexane-1,3-dione |
|
| | 1,2-Benzenedicarboxylic acid, dihexyl ester, branched and linear |
|
| | Spirotetramat (ISO); (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4,5]dec-3-en-4-yl ethyl carbonate |
|
| | Dodemorph acetate; 4-cyclododecyl-2,6-dimethylmorpholin-4-ium acetate |
|
| | Triflusulfuron-methyl; methyl 2-({[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)-3-methylbenzoate |
|
| | Imazalil (ISO); 1-[2-(allyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole |
|
| | Dodemorph (ISO); 4-cyclododecyl-2,6-dimethylmorpholine |
|
| |
| | Lenacil (ISO); 3-cyclohexyl-6,7-dihydro-1H-cyclopenta[d]pyrimidine-2,4(3H,5H)-dione |
|
| | Metosulam (ISO); N-(2,6-dichloro-3-methylphenyl)-5,7-dimethoxy[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
|
| | 2-Methyl-1-(4-methylthiophenyl)-2-morpholino-propan 1-one |
|
| | 2,3-Epoxypropyl methacrylate; glycidyl methacrylate |
|
| | Spiroxamine (ISO); 8-tert-butyl-1,4-dioxaspirol[4.5]decan-2-ylmethyl(ethyl)(propyl)amine |
|
| |
| | Cyproconazole (ISO); (2RS,3RS;2RS,3SR)-2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol |
|
| |
| | Cadmium hydroxide; cadmium dihydroxide |
|
| | Cadmium nitrate; cadmium dinitrate |
|
| | Dibutyltin dilaurate; dibutyl[bis(dodecanoyloxy)] stannane |
|
| | Clorofene; chlorophene; 2-benzyl-4-chlorophenol |
|
| | 9,10-anthraquinone; Anthraquinone |
|
| | Nonadecafluorodecanoic acid; Ammonium nonadecafluorodecanoate; Sodium nonadecafluorodecanoate |
|
| | N,N’-Methylenedimorpholine; N,N’-methylenebismorpholine; [formaldehyde released from N,N’-Methylenebismorpholine]; [MBM] if the maximum theoretical concentration of releasable formaldehyde, irrespective of the source, in the mixture as placed on the market is ≥ 0.1% w/w |
|
| | Reaction products of paraformaldehyde with 2-hydroxypropylamine (3:2); [formaldehyde released from 3,3’-methylenebis[5–methyloxazolidine]; [formaldehyde released from oxazolidin]; [MBO] if the maximum theoretical concentration of releasable formaldehyde, irrespective of the source, in the mixture as placed on the market is ≥ 0.1% w/w |
|
| | Reaction products of paraformaldehyde with 2-hydroxypropylamine (1:1)); [formaldehyde released from α,α,α-trimethyl-1,3,5-triazine-1,3,5(2H,4H,6H)-triethanol]; [HPT] if the maximum theoretical concentration of releasable formaldehyde, irrespective of the source, in the mixture as placed on the market is ≥ 0.1% w/w |
|
| |
| | Triadimenol (ISO); (1RS,2RS;1RS,2SR)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol; a-tert-butyl-ß-(4-chlorophenoxy)-1H-1,2,4-triazole-1-ethanol |
|
| | Thiacloprid (ISO); (Z)-3-(6-chloro-3-pyridyl-methyl)-1-3-thiazolidin-2-ylidenecyanamide; {(2Z)-3-[(6-chloropyridin-3-yl)methyl]-1,3-thiazolidin-2-ylidene}cyanamide |
|
| | Carbetamide (ISO); (R)-1-(ethylcarbamoyl) ethyl-carbanilate;(2R)-1-(ethylamino) -1-oxopro-pan-2-yl-phenylcarbamate |
|
| | Phosmet (ISO); S-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl]-O,O-dimethyl phosphorodithioate; O,O-dimethyl-Sphthalimidomethyl phosphorodithioate |
|
| |
| | 2-Benzyl-2-dimethylamino-4’-morpholinobutyrophenone |
|
| | Quizalofop-p-tefuryl (ISO); (+/–) tetrahydrofurfuryl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenyloxy]propionate |
|
| | Propiconazole (ISO); (2RS,4RS;2RS,4SR)-1-{[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl}-1H-1,2,4-triazole |
|
| | Pinoxaden (ISO); 8-(2,6-diethyl-4-methylphenyl)-7-oxo-1,2,4,5-tetrahydro-7H-pyrazolo[1,2-d][1,4,5]oxadiazepin-9-yl 2,2-dimethylpropanoate |
|
| | Tetramethrin; (1-Cyclohexene-1,2-Dicarboximido)Methyl Chrysanthemate; 2,2-Dimethyl-3-(2-Methyl-1-Propenyl)Cyclopropanecarboxylic Acid (1,3,4,5,6,7-Hexahydro-1,3-Dioxo-2H-Isoindol-2-yl)Methyl Ester |
|
| | (1,3,4,5,6,7-Hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl (1Rtrans)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
|
| | Spirodiclofen (ISO); 3-(2,4-dichlorophenyl)-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl 2,2-dimethylbutyrate |
|
| | Reaction mass of 1-[2-(2-aminobutoxy)ethoxy]but-2-ylamine and 1-({[2-(2-aminobutoxy)ethoxy]methyl}propoxy) but-2-ylamine |
|
| |
| | Amisulbrom (ISO)3-(3-bromo-6-fluoro-2-methylindol-1-ylsulfonyl)-N,N-dimethyl-1H-1,2,4-triazole-1-sulfonamide |
|
| | Pirimicarb (ISO); 2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl dimethylcarbamate |
|
| | 1,2-Dichloropropane; propylene dichloride |
|
| | Phenol, dodecyl-, branched; Phenol, 2-dodecyl-, branched; Phenol, 3-dodecyl-, branched; Phenol, 4-dodecyl-, branched; Phenol, (tetrapropenyl) derivatives |
|
| | Coumatetralyl (ISO); 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl) coumarin |
|
| | Difenacoum (ISO); 3-(3-biphenyl-4-yl-1,2,3,4-tetrahydro-1-naphthyl)-4-hydroxycoumarin |
|
| | Brodifacoum (ISO); 4-hydroxy-3-(3-(4’-bromo-4-biphenylyl)-1,2,3,4-tetrahydro-1-naphthyl)coumarin |
|
| | Flocoumafen (ISO); reaction mass of: cis-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin and trans-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin |
|
| | Acetochlor (ISO); 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide |
|
| | e-Glass microfibres of representative composition |
|
| | Glass microfibres of representative composition |
|
| | Bromadiolone (ISO); 3-[3-(4’-bromobiphenyl-4-yl)-3-hydroxy-1-phenylpropyl]-4-hydroxy-2H-chromen-2-one |
|
| | Difethialone (ISO); 3-[3-(4’-bromobiphenyl-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-hydroxy-2H-1-benzothiopyran-2-one |
|
| | Perfluorononan-1-oic acid and its sodium and ammonium salts |
|
| |
| | 3,7-Dimethylocta-2,6-dienenitrile |
|
| | Bupirimate (ISO); 5-butyl-2-ethylamino-6-methylpyrimidin-4-yldimethylsulphamate |
|
| | Triflumizole (ISO); (1E)-N-[4-chloro-2-(trifluoromethyl) phenyl]-1-(1H-imidazol-1-yl)-2-propoxyethanimine |
|
| |
| | 1,2,4-Trihydroxybenzene, when used as a substance in hair and eyelash dye products |
|
| | 4-Amino-3-hydroxytoluene, when used as a substance in hair and eyelash dye products |
|
| | 2-[(4-Amino-2-nitrophenyl)-amino]-benzoic acid, when used as a substance in hair and eyelash dye products |
|
| |
| | Metaldehyde (ISO); 2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane |
|
| |
| |
| | Dibenzo[b,def]chrysene; dibenzo[a,h]pyrene |
|
| | Ethanol, 2,2’-iminobis-, N-(C13-15-branched and linear alkyl) derivatives |
|
| | Cyflumetofen (ISO); 2-methoxyethyl (RS)-2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-(α,α,α-trifluoro-o-tolyl)propionate |
|
| |
| | Halosulfuron-methyl (ISO); methyl 3-chloro-5-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl] sulfamoyl}-1-methyl-1H-pyrazole-4-carboxylate |
|
| |
| | Metaflumizone (ISO); (EZ)-2’-[2-(4-cyanophenyl)-1-(α,α,α-trifluoro-m- tolyl)ethylidene]-[4-(trifluoromethoxy)phenyl]carbanilohydrazide [E-isomer ≥ 90%, Z-isomer ≤ 10% relative content]; (E)-2’-[2-(4-cyanophenyl)-1-(α,α,α-trifluoro-m-tolyl)ethylidene]-[4-(trifluoromethoxy)phenyl]carbanilohydrazide |
|
| | Dibutylbis(pentane-2,4-dionato-O,O’)tin |
|
| | 4-[(tetrahydro-2H-pyran-2-yl)oxy]phenol (Deoxyarbutin, Tetrahydropyranyloxy Phenol) |
|
| | Silicon carbide fibres (with diameter < 3 µm, length > 5 µm and aspect ratio ≥ 3:1) |
|
| | Tris(2-methoxyethoxy)vinylsilane; 6-(2-methoxyethoxy)-6-vinyl-2,5,7,10-tetraoxa-6-silaundecane |
|
| | Dioctyltin dilaurate; Stannane, dioctyl-, bis(coco acyloxy) derivatives |
|
| | Dibenzo[def,p]chrysene; dibenzo[a,l]pyrene |
|
| | Ipconazole (ISO); (1RS,2SR,5RS;1RS,2SR,5SR)-2-(4-chlorobenzyl)-5-isopropyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
|
| | Bis(2-(2-methoxyethoxy)ethyl)ether; Tetraglyme |
|
| | Paclobutrazol (ISO); (2RS,3RS)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pentan-3-ol |
|
| | 2,2-bis(bromomethyl)propane-1,3-diol |
|
| | 2-(4-tert-butylbenzyl)propionaldehyde |
|
| |
| |
| | Flurochloridone (ISO); 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|
| | 3-(difluoromethyl)-1-methyl-N-(3’,4’,5’-trifluorobiphenyl-2-yl)pyrazole-4-carboxamide; Fluxapyroxad |
|
| | N-(hydroxymethyl)acrylamide; methylolacrylamide; [NMA] |
|
| | 5-fluoro-1,3-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-4-carboxamide; 2’-[(RS)-1,3-dimethylbutyl]-5-fluoro-1,3-dimethylpyrazole-4-carboxanilide; penflufen |
|
| | Iprovalicarb (ISO); isopropyl [(2S)-3-methyl-1-{[1-(4-methylphenyl)ethyl]amino}-1-oxobutan-2-yl]carbamate |
|
| |
| | Mesotrione (ISO); 2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione |
|
| | Hymexazol (ISO); 3-hydroxy-5-methylisoxazole |
|
| | Imiprothrin (ISO); reaction mass of: [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-cis-chrysanthemate; [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-trans-chrysanthemate |
|
| | Bis(α,α-dimethylbenzyl) peroxide |
|
| |
| | 6,6’-di-tert-butyl-2,2’-methylenedi-p-cresol; [DBMC] |
|
| | (5-chloro-2-methoxy-4-methyl-3-pyridyl)(4,5,6-trimethoxy-o-tolyl)methanone; Pyriofenone |
|
| | (RS)-1-{1-ethyl-4-[4-mesyl-3-(2-methoxyethoxy)-o-toluoyl]pyrazol-5-yloxy}ethyl methyl carbonate; Tolpyralate |
|
| | Azamethiphos (ISO); S-[(6-chloro-2-oxooxazolo[4,5-b]pyridin-3(2H)-yl)methyl] O,O-dimethyl thiophosphate |
|
| |
| | N-methoxy-N-[1-methyl-2-(2,4,6-trichlorophenyl)-ethyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide; Pydiflumetofen |
|
| | N-{2-[[1,1’-bi(cyclopropyl)]-2-yl]phenyl}-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide; Sedaxane |
|
| | 4-methylpentan-2-one; isobutyl methyl ketone; (MIBK) |
|
| | Dimethomorph (ISO); 4-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)acryloyl)morpholine |
|
| | Imazamox (ISO); (RS)-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-methoxymethylnicotinic acid |
|
| | Thiamethoxam (ISO); 3-(2-chloro-thiazol-5-ylmethyl)-5-methyl[1,3,5]oxadiazinan-4-ylidene-N-nitroamine |
|
| | Triticonazole (ISO); (RS)-(E)-5-(4-chlorobenzylidene)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
|
| | Desmedipham (ISO); ethyl 3-phenylcarbamoyloxyphenylcarbamate |
|
| |
| | Dibutyltin bis(2-ethylhexanoate) |
|
| |
| |
| | Barium diboron tetraoxide |
|
| | 2,2-dimethylpropan-1-ol,tribromo derivative; 3-bromo-2,2-bis(bromomethyl)propan-1-ol |
|
| | 2,4,6-tri-tert-butylphenol |
|
| | 4,4’-sulphonyldiphenol; bisphenol S |
|
| | Quinoclamine (ISO); 2-amino-3-chloro-1,4-naphthoquinone |
|
| | Perfluoroheptanoic acid; tridecafluoroheptanoic acid |
|
| | Methyl N-(isopropoxycarbonyl)-L-valyl-(3RS)- 3-(4-chlorophenyl)-β-alaninate; valifenalate |
|
| | 6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid, sodium and tris(2-hydroxyethyl)ammonium salts |
|
| | 6-[(C10-C13)-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
|
| | 6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
|
| | 1,3,5-triazine-2,4,6-triamine; melamine |
|
| | Fluopicolide (ISO); 2,6-dichloro-N-[3-chloro-5-(trifluoromethyl)-2-pyridylmethyl]benzamide |
|
| | N-(2-nitrophenyl)phosphoric triamide |
|
| | N-(5-chloro-2-isopropylbenzyl)-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxamide; isoflucypram |
|
| | Reaction mass of 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9RS)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide and 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9SR)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide [≥ 78 % syn isomers ≤ 15 % anti isomers relative content]; isopyrazam |
|
| |
| | Pentapotassium 2,2’,2’’,2’’’,2’’’’-(ethane-1,2-diylnitrilo) pentaacetate |
|
| | Acetamiprid (ISO); (1E)-N-[(6-chloropyridin-3-yl) methyl]-N’-cyano-N-methylethanimidamide; (E)-N1-[(6-chloro-3-pyridyl) methyl]-N2-cyano-N1-methylacetamidine |
|
| | Pendimethalin (ISO); N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidene |
|
| | Bentazone (ISO); 3-isopropyl-2,1,3-benzothiadiazine-4-one-2,2-dioxide |
|